Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-하이드록시페닐알코올
2-하이드록시페닐알코올 · 2-(2-Hydroxyethyl)phenol · 2-hydroxyphenylethanol · o-Hydroxyphenylethanol · 2-Hydroxybenzeneethanol · o-(2-Hydroxyethyl)phenol · o-Hydroxyphenethyl alcohol · 2-(o-Hydroxyphenyl)ethanol
식별자 및 물리적 특성
| CAS No. | 7768-28-7 |
|---|---|
| 분자식 | C8H10O2 |
| 평균 분자량 | 138.16 g/mol |
| 단동위원소 질량 | 138.06807956 g/mol |
| SMILES | OCCc1ccccc1O |
| InChIKey | ABFCOJLLBHXNOU-UHFFFAOYSA-N |
| PubChem CID | 82200 |
| ChEMBL | CHEMBL4075005 |
| ChEBI | CHEBI:64803 |
| EC No. | 231-863-3 |
| DTXSID | DTXSID90228312 |
| 현지명 | 2-하이드록시페닐알코올 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 40.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 93.3 |
| 끓는 점 | 168-169 °C2 mm Hg(lit.) |
| 밀도 | 1.159 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.559(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름, DMSO(약간), 메탄올(약간)에 용해됨 |
| pKa(산도 계수) | 10.24±0.30(Predicted) |
| 물리적 상태 | 점성 액체 |
| 색상 | 투명한 노란색에서 황갈색을 띤다. |
| 안정성 | 감광성 |
| InChI | InChI=1S/C8H10O2/c9-6-5-7-3-1-2-4-8(7)10/h1-4,9-10H,5-6H2 |
| InChIKey | ABFCOJLLBHXNOU-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1O |
| LogP(분배 계수) | 1.310 (est) |
화학적 성질
Clear yellow liquid
안전 및 규제
| GHS 분류 | DangerH302 (97.7%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 18-05-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/22844 |
| Hazard Classes and Categories | Acute Tox. 4 (97.7%) |
| 수질 위해 등급(WGK) | 2 |
| 관세 코드 | 29072990 |
| 위험 문구(R) | 22-41-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-37/39-36 |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2-Hydroxybenzeneethanol can be used to synthesize cyclic products and organoaluminim oligomers. Inelastic electron tunnelling spectra of 2-hydroxyphenethyl alcohol adsorbed on thin-film aluminium and magnesium oxide has been investigated.
일반 설명
2-Hydroxyphenethyl alcohol reacts with triethyl or trimethyl aluminium to yield cyclic products and organoaluminim oligomers. Inelastic electron tunnelling spectra of 2-hydroxyphenethyl alcohol adsorbed on thin-film aluminium and magnesium oxide has been investigated.