Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromo-5-nitroaniline
AKOS BBS-00001987 · 2-Bromo-5-nitroaniL · 2-BROMO-5-NITROANILINE · 2-Bromo-5-nitroaniline,98% · 2-Bromo-5-nitroaniline >2-Bromo-5-nitroaniline 98% · 3-Amino-4-bromonitrobenzene · Benzenamine, 2-bromo-5-nitro- · 2-Bromo-5-nitroaniline, GC 98%
식별자 및 물리적 특성
| CAS No. | 10403-47-1 |
|---|---|
| 분자식 | C6H5BrN2O2 |
| 평균 분자량 | 217.02 g/mol |
| 단동위원소 질량 | 215.9534395 g/mol |
| SMILES | Nc1cc([N+](=O)[O-])ccc1Br |
| InChIKey | BAAUCXCLMDAZEL-UHFFFAOYSA-N |
| PubChem CID | 82607 |
| ChEMBL | CHEMBL106285 |
| EC No. | 233-874-9 |
| DTXSID | DTXSID50146225 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 71.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 159 |
| 녹는점 | 139-141 °C (lit.) |
| 끓는 점 | 334.5±22.0 °C(Predicted) |
| 밀도 | 1.7917 (rough estimate) |
| 굴절률 | 1.5150 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| pKa(산도 계수) | 0.49±0.10(Predicted) |
| 물리적 상태 | 바늘 모양 또는 벌크 결정 |
| 색상 | 진한 노란색에서 카키색까지 |
| 용해도 | 약간 용해됨 |
| BRN | 2803492 |
| InChI | 1S/C6H5BrN2O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,8H2 |
| InChIKey | BAAUCXCLMDAZEL-UHFFFAOYSA-N |
| SMILES | Nc1cc(ccc1Br)[N+]([O-])=O |
| NIST | 2-Bromo-5-nitroaniline(10403-47-1) |
화학적 성질
dark yellow to khaki fine crystalline needles or
안전 및 규제
| GHS 분류 | WarningH302 (15.2%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (15.2%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Bromo-5-nitroaniline reacts with phosgene iminium chloride to give a dimethylcarbamimidic chloride intermediate, which is then treated with primary amines to form guanidinyl derivatives and ultimately 5-nitrobenzimidazole derivatives[1]. 2-Bromo-5-nitroaniline can be acetylated and then thionated to give the corresponding thioamide, or heated with an amide and POCl3 in toluene to afford amidine derivatives[2].