Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
싸이티오산
싸이티오산 · 사이티오에이트 · O,O-다이메틸 O-(4-설팜오일페닐) 싸이오포스페이트 · O,O-다이메틸 O-(4-설팜오일페닐) 포스포로싸이오에이트 · O,O-다이메틸 O-(p-설팜오일페닐) 포스포로싸이오에이트 · O,O-디메틸O-(4-(아미노술포닐)페닐)티오인산 · 포스포로싸이오 산, O-[4-(아미노설폰일)페닐] O,O-다이메틸 에스터 · 포스포로싸이오산, O,O-다이메틸 O-p-설팜오일페닐 에스터
식별자 및 물리적 특성
| CAS No. | 115-93-5 |
|---|---|
| 분자식 | C8H12NO5PS2 |
| 평균 분자량 | 297.3 g/mol |
| 단동위원소 질량 | 296.98945183 g/mol |
| SMILES | COP(=S)(OC)Oc1ccc(S(N)(=O)=O)cc1 |
| InChIKey | BSBSDQUZDZXGFN-UHFFFAOYSA-N |
| PubChem CID | 8293 |
| ChEMBL | CHEMBL2104588 |
| EC No. | 204-115-9 |
| DTXSID | DTXSID8041828 |
| 현지명 | 싸이티오산 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 128 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 377 |
| SpringerMaterials Properties | Fusion temperature |
| Animal Drugs | FDA approved animal drugs -> Active ingredient |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 70-71° |
| 끓는 점 | 407.7±55.0 °C(Predicted) |
| 밀도 | 1.459±0.06 g/cm3(Predicted) |
| 굴절률 | nD25 1.5346 |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 수정 같은 |
| pKa(산도 계수) | 10.04±0.10(Predicted) |
| BRN | 2148114 |
| 주요 응용 | 농업환경 |
| InChI | 1S/C8H12NO5PS2/c1-12-15(16,13-2)14-7-3-5-8(6-4-7)17(9,10)11/h3-6H,1-2H3,(H2,9,10,11) |
| InChIKey | BSBSDQUZDZXGFN-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc(cc1)S(N)(=O)=O |
| NIST | Cythioate(115-93-5) |
| EPA | Cythioate (115-93-5) |
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Cythioate: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| 기타 안전 정보 | IMAP assessments - Phosphorothioic acid, O-[4-(aminosulfonyl)phenyl] O,O-dimethyl ester: Human health tier I assessment |
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 2783 |
| 독성 | LD50 orally in rats: 160 mg/kg (Kenaga, Allison) |
| 관세 코드 | 29350090 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Acute Tox. 3 Oral |
| 기존화학 물질 | KE-05-0506 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| 함량 및 규제정보 | 물질구분: 유독물질혼합물(제품)함량정보: 싸이티오산 및 이를 1% 이상 함유한 혼합물 |
| 유해화학물질 필터링 | 97-1-149 |
용도
개요
Cythioate is a member of the organothiophosphate compounds that is used as an insecticide and anthelmintic. It has been sold under the trade names Cyflee and Proban, under which form it has been used for veterinary purposes against fleas.
용도
Cythioate is used as pesticide.