Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-(벤질옥시카보닐옥시)석신이미드
N-(벤질옥시카보닐옥시)석신이미드 · Cbz-Cl · CBZ-OSU · Z-OSU · BENZYL N-SUCCINIMIDYL CARBONATE · benzyl 2,5-dioxopyrrolidin-1-yl carbonate · CBZ-ONSU · benzyl succinimido carbonate
식별자 및 물리적 특성
| CAS No. | 13139-17-8 |
|---|---|
| 분자식 | C12H11NO5 |
| 평균 분자량 | 249.22 g/mol |
| 단동위원소 질량 | 249.06372245 g/mol |
| SMILES | O=C(OCc1ccccc1)ON1C(=O)CCC1=O |
| InChIKey | MJSHDCCLFGOEIK-UHFFFAOYSA-N |
| PubChem CID | 83172 |
| EC No. | 236-075-3 |
| DTXSID | DTXSID20157020 |
| 현지명 | N-(벤질옥시카보닐옥시)석신이미드 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 72.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 332 |
| 녹는점 | 80-82 °C(lit.) |
| 끓는 점 | 392.32°C (rough estimate) |
| 밀도 | 1.3189 (rough estimate) |
| 굴절률 | 1.5560 (estimate) |
| 인화점 | 81°C |
| 저장 조건 | Keep in dark place,Inert atmosphere,2-8°C |
| 용해도 | 에 용해됨 아세톤: 0.1 g/mL, 투명 |
| 물리적 상태 | 미세 결정성 분말 |
| 색상 | 흰색에서 황백색까지 |
| BRN | 1387927 |
| 안정성 | 안정적인. 수분에 민감합니다. |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C12H11NO5/c14-10-6-7-11(15)13(10)18-12(16)17-8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | MJSHDCCLFGOEIK-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)ON1C(=O)CCC1=O |
화학적 성질
white crystal powde
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 69.2% (9 of 13) of all reports.WarningH315 (23.1%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P272, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 13 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 28-02-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/190712,5-Pyrrolidinedione, 1-(phenylmethoxy)carbonyloxy-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (23.1%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29252900 |
| 위험 문구(R) | 43-24/25-36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 22-24/25-36-26 |
| 기존화학 물질 | 97-3-147 |
| F 고인화성물질 | 8-10 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Reagents for the selective introduction of the Z-protecting group into amino compounds