Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Anthrarufin
1,5-dihydroxyanthracene-9,10-dione · ANTHRARUFIN · C14H8O4 · NSC 7211 · NSC 646570 · Anthrarufin,80% · Anthrarufin 85% · Anthrarufin >1,5 DIHYDROXY AQ
식별자 및 물리적 특성
| CAS No. | 117-12-4 |
|---|---|
| 분자식 | C14H8O4 |
| 평균 분자량 | 240.21 g/mol |
| 단동위원소 질량 | 240.04225874 g/mol |
| SMILES | O=C1c2cccc(O)c2C(=O)c2cccc(O)c21 |
| InChIKey | JPICKYUTICNNNJ-UHFFFAOYSA-N |
| PubChem CID | 8328 |
| ChEMBL | CHEMBL55761 |
| ChEBI | CHEBI:37501 |
| EC No. | 204-175-6 |
| DTXSID | DTXSID8051594 |
화학 및 물리적 성질
| XLogP | 3.7 |
|---|---|
| 극성 표면적 | 74.6 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 342 |
| 물질 분류 | Dyes -> Anthraquinone Dyes |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Physical Description | Green to yellow solid[Merck Index] Yellow powder[Alfa Aesar MSDS] |
| 녹는점 | 279 °C (dec.)(lit.) |
| 끓는 점 | 342.92°C (rough estimate) |
| 밀도 | 1.56 g/cm3 |
| 증기 밀도 | 8.3 (vs air) |
| 굴절률 | 1.5430 (estimate) |
| 저장 조건 | -20°C Freezer |
| 용해도 | 테스트된 모든 용매에 대한 용해도가 낮습니다.DMSO(드물게) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 6.42±0.20(Predicted) |
| 색상 | 노란색에서 녹색으로 |
| Merck | 14,689 |
| BRN | 1881718 |
| InChI | InChI=1S/C14H8O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-16H |
| InChIKey | JPICKYUTICNNNJ-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C=CC=C3O)=CC=C1 |
| EPA | Anthrarufin (117-12-4) |
화학적 성질
Yellow to Green Solid
안전 및 규제
| GHS 분류 | WarningH315 (97.5%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 9,10-Anthracenedione, 1,5-dihydroxy- |
| 기타 안전 정보 | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
| 유해성 요약 | A mild eye irritant[RTECS] May cause irritation[Alfa Aesar MSDS] See Alizarin. |
| Hazard Classes and Categories | Skin Irrit. 2 (97.5%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | CB6630000 |
| 관세 코드 | 29146990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-36/37 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1,5-Dihydroxyanthraquinone is an anthraquinone derivative with suppressive effects against nitric oxide (NO) synthase. Potential antimalarial agent. Used in studies as a potential competitive non-peptidic inhibitor of HIV-1 protei nase.