식별자 및 물리적 특성
| CAS No. | 34743-34-5 |
|---|
| 분자식 | C16H17NO |
|---|
| 평균 분자량 | 239.31 g/mol |
|---|
| 단동위원소 질량 | 239.13101417 g/mol |
|---|
| SMILES | Cc1ccccc1C(=O)Nc1c(C)cccc1C |
|---|
| InChIKey | LJKPEPJBLNQBBK-UHFFFAOYSA-N |
|---|
| PubChem CID | 836331 |
|---|
| EC No. | 666-031-2 |
|---|
화학 및 물리적 성질
| XLogP | 3.3 |
|---|
| 극성 표면적 | 29.1 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 1 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 18 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 279 |
|---|
안전 및 규제
| GHS 분류 | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H319 |
|---|
