Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
트리 -tert- 부틸 포스 핀
트리-tert-부틸포스핀 · P(t-Bu)3 · TTBP · TRI-T-BUTYLPHOSPHINE · Tri-tert-butyL · Butylphosphine · ri-tert-butylphosphine · Tris(tert-butyl)phosphine
식별자 및 물리적 특성
| CAS No. | 13716-12-6 |
|---|---|
| 분자식 | C12H27P |
| 평균 분자량 | 202.32 g/mol |
| 단동위원소 질량 | 202.18503749 g/mol |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N |
| PubChem CID | 83681 |
| EC No. | 237-266-4 |
| DTXSID | DTXSID80160090 |
| 현지명 | 트리 -tert- 부틸 포스 핀 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 128 |
| SpringerMaterials Properties | Schoenflies notation |
| 녹는점 | 30-35 °C(lit.) |
| 끓는 점 | 102-103 °C13 mm Hg(lit.) |
| 밀도 | 0.861 g/mL at 25 °C |
| 인화점 | 1 °F |
| 저장 조건 | Flammables area |
| 물리적 상태 | 고체 |
| 비중 | 0.68 |
| 용해도 | 불용성 |
| BRN | 1738613 |
| InChI | InChI=1S/C12H27P/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3 |
| InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N |
| SMILES | P(C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| NIST | Tri-tert-butylphosphine(13716-12-6) |
화학적 성질
Colorless to light yellow liqui
안전 및 규제
| GHS 분류 | DangerH250 (98.2%): Catches fire spontaneously if exposed to air [Danger Pyrophoric liquids]P210, P222, P231, P233, P260, P264, P264+P265, P280, P301+P330+P331, P302+P335+P334, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P370+P378, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 57 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Pyr. Liq. 1 (98.2%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2846 4.2/PG 1 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 17-34-67-65-63-48/20-11 |
| 위험 표시 | F,C |
| 안전 문구(S) | 26-45-62-36/37/39-25-43-27-16 |
| 포장분류 | I |
| 위험 등급 | 4.2Carc. 2Eye Dam. 1Flam. Liq. 2Pyr. Liq. 1Skin Corr. 1BSTOT SE 3 |
| 기존화학 물질 | 2010-3-4569 |
| F 고인화성물질 | 10-19-23 |
| 저장 분류 | 4.2 - Pyrophoric and self-heating hazardous materials |
용도
용도
Tri-tert-butylphosphine is used primarily in the preparation of mono- and bidentate phosphine ligands in metal complexes for catalytic chiral asymmetric hydrogenations and other asymmetric reactions as well as transition metal coupling reactions. This reagent is also used in the preparation of other phosphines in catalytic polymerization reactions.