Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(3,4-Dihydroxyphenyl)-2-((1-methylethyl)amino)ethanone
S 35179 · NSC 163353 · Isoproterenon · N-Isopropylnoradrenalone · 34'-dihyfroxy-2- (isopropylaminojacetophenone · 3',4'-Dihydroxy-α-(isopropylamino)acetophenone · 3',4'-dihydroxy-2-(isopropylamino)acetophenone · 3',4'-dihydroxy-2-(isopropylamino)-acetophenon
식별자 및 물리적 특성
| CAS No. | 121-28-8 |
|---|---|
| 분자식 | C11H15NO3 |
| 평균 분자량 | 209.24 g/mol |
| 단동위원소 질량 | 209.10519334 g/mol |
| SMILES | CC(C)NCC(=O)c1ccc(O)c(O)c1 |
| InChIKey | BIQMIYWSZZTXEX-UHFFFAOYSA-N |
| PubChem CID | 8465 |
| ChEMBL | CHEMBL598662 |
| EC No. | 204-461-0 |
| DTXSID | DTXSID90153099 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 69.6 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 218 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 96℃ |
| 밀도 | 1.185±0.06 g/cm3 (20 ºC 760 Torr) |
| InChI | InChI=1S/C11H15NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,12-14H,6H2,1-2H3 |
| InChIKey | BIQMIYWSZZTXEX-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(O)C(O)=C1)C(=O)CNC(C)C |
제조 및 합성 방법
제조 방법
Obtained by reductive condensation of 3,4-dihydroxy-phenylglyoxal with isopropylamine in ethanol under hydrogen atmosphere in the presence of 14% Pd/C.