Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Pyridinecarbonitrile, 1-oxide
4-Cyanopyridine 1-oxide · NSC 132883 · 4-cyanopyridine oxide · 4-Cyanopyride N-oxide · 4-CYANOPYRIDINE N-OXIDE · 1-Oxy-isonicotinonitrile · Topiroxostat Impurity 54 · 4-CYANOPYRIDINIUM-1-OLATE
식별자 및 물리적 특성
| CAS No. | 14906-59-3 |
|---|---|
| 분자식 | C6H4N2O |
| 평균 분자량 | 120.11 g/mol |
| 단동위원소 질량 | 120.03236275 g/mol |
| SMILES | N#Cc1cc[n+]([O-])cc1 |
| InChIKey | QNCSFBSIWVBTHE-UHFFFAOYSA-N |
| PubChem CID | 84684 |
| ChEMBL | CHEMBL5206267 |
| EC No. | 238-974-6 |
| DTXSID | DTXSID3065827 |
화학 및 물리적 성질
| XLogP | -0.9 |
|---|---|
| 극성 표면적 | 49.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 129 |
| 녹는점 | 223-225 °C(lit.) |
| 끓는 점 | 382.7±15.0 °C(Predicted) |
| 밀도 | 1.14±0.1 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 1 M NH4OH: 가용성 5mg/mL, 투명, 무색(메탄올) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -0.86±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C6H4N2O/c7-5-6-1-3-8(9)4-2-6/h1-4H |
| InChIKey | QNCSFBSIWVBTHE-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(C#N)C=1 |
| NIST | 4-Pyridinecarbonitrile, 1-oxide(14906-59-3) |
| EPA | 4-Pyridinecarbonitrile 1-oxide (14906-59-3) |
화학적 성질
Pale-Green Solid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-37/39-36/37/39-22-36 |
| 위험 등급 | IRRITANTAcute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
4-Cyanopyridine N-oxide is a heterocyclic compound and is an intermediate in the preparation of Topiostat. It is also used as a ligand for other metals or compounds for the formation of new dimeric complexes. It is commonly used in chemical materials research.