Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,1,3,3-Tetramethyldisilazane, 97%
TMDS · TETRAMETHYLDISILAZANE · Bis(dimethylsilyl)amine · Bisdimethylsilylamine · DK097 · Bis(dimethylsilyl) imide · Iminobis(dimethylsilane) · TETRAMETHYLDISILAZANE 98+%
식별자 및 물리적 특성
| CAS No. | 15933-59-2 |
|---|---|
| 분자식 | C4H15NSi2 |
| 평균 분자량 | 133.34 g/mol |
| 단동위원소 질량 | 133.07430255 g/mol |
| SMILES | C[SiH](C)N[SiH](C)C |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| PubChem CID | 85196 |
| DTXSID | DTXSID80884860 |
화학 및 물리적 성질
| 극성 표면적 | 12 |
|---|---|
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 39 |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| 녹는점 | 99-100 °C |
| 끓는 점 | 100 °C |
| 밀도 | 0.77 |
| 굴절률 | 1.41 |
| 인화점 | -8 °C |
| 저장 조건 | Store below +30°C. |
| 용해도 | 일반적인 유기용매와 섞일 수 있습니다. |
| pKa(산도 계수) | 9.80±0.70(Predicted) |
| 물리적 상태 | clear liquid |
| 색상 | Colorless to Almost colorless |
| 비중 | 0.752 |
| BRN | 741869 |
| InChI | 1S/C4H15NSi2/c1-6(2)5-7(3)4/h5-7H,1-4H3 |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)N[Si]([H])(C)C |
| EPA | Silanamine, N-(dimethylsilyl)-1,1-dimethyl- (15933-59-2) |
화학적 성질
Clear colorless to faintly yellow liquid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 2924 3/PG 2 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 11-36/37/38 |
| 위험 표시 | F,Xi |
| 안전 문구(S) | 16-26-36 |
| 포장분류 | II |
| 위험 등급 | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
1,1,3,3-Tetramethyldisilazane is widely used in intramolecular hydrosilation of allyl alcohols, homoallyl alcohols, and homopropargyl alcohols for the regio- and stereoselective synthesis of polyols