Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-Dichloro-3-nitropyridine
6-Dichloro-3-nitropyridine · PYRIDINE, 2,6-DICHLORO-3-NITRO- · 26DC3NP · TIMTEC-BB SBB003614 · 2,6-Dichloro-3-nitro · Flupirtine Impurity H · DICHLORONITROPYRIDINE · Dichloro-3-nitropyrid
식별자 및 물리적 특성
| CAS No. | 16013-85-7 |
|---|---|
| 분자식 | C5H2Cl2N2O2 |
| 평균 분자량 | 192.98 g/mol |
| 단동위원소 질량 | 191.94933266 g/mol |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1Cl |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| PubChem CID | 85239 |
| EC No. | 240-151-1 |
| DTXSID | DTXSID10166803 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 58.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 161 |
| LogP(분배 계수) | 1.96 |
| 녹는점 | 55-60 °C(lit.) |
| 끓는 점 | 295.5±35.0 °C(Predicted) |
| 밀도 | 1.6791 (rough estimate) |
| 굴절률 | 1.6100 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | -5.76±0.10(Predicted) |
| 색상 | 무색투명~연황색 |
| BRN | 1619741 |
| InChI | InChI=1S/C5H2Cl2N2O2/c6-4-2-1-3(9(10)11)5(7)8-4/h1-2H |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1[N+]([O-])=O |
화학적 성질
yellow crystalline powder or chunks
안전 및 규제
| GHS 분류 | WarningH315 (95.8%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P272, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (95.8%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38-42/43-43 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-26-36/37-37/39-24-36/37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2Skin Sens. 1STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,6-Dichloro-3-nitropyridine was used:in the synthesis of pyridyldifluoroacetatesas starting reagent in the preparation of bicyclooxacalixhetarene
용도
2,6-Dichloro-3-nitropyridine is a starting compound for the synthesis of a sulfide analog of Flupirtine with KV7.2/3 channel opening activity. 2,6-Dichloro-3-nitropyridine can be used in pain research.
일반 설명
2,6-Dichloro-3-nitropyridine undergoes macrocyclic condensation reaction with resorcinol derivatives to yield chiral tetraoxacalix[2]arene[2]pyridines.