Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-(4-니트로페녹시)에탄올
2-(4-니트로페녹시)에탄올 · Ai3-19441 · Nsc 30512 · NSC 47172 · AKOS B030715 · Einecs 240-422-4 · TIMTEC-BB SBB008154 · p-Nitrophenoxyethanol
식별자 및 물리적 특성
| CAS No. | 16365-27-8 |
|---|---|
| 분자식 | C8H9NO4 |
| 평균 분자량 | 183.16 g/mol |
| 단동위원소 질량 | 183.05315777 g/mol |
| SMILES | O=[N+]([O-])c1ccc(OCCO)cc1 |
| InChIKey | YAPAEYFBLRVUMH-UHFFFAOYSA-N |
| PubChem CID | 85381 |
| ChEMBL | CHEMBL5488354 |
| EC No. | 240-422-4 |
| DTXSID | DTXSID5066037 |
| 현지명 | 2-(4-니트로페녹시)에탄올 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 75.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| 녹는점 | 82-85 °C |
| 끓는 점 | 182°C 11mm |
| 밀도 | 1,322 g/cm3 |
| 저장 조건 | Store at room temperature |
| pKa(산도 계수) | 13.93±0.10(Predicted) |
| 물리적 상태 | flakes |
| BRN | 2210596 |
| EPA | 2-(4-Nitrophenoxy)ethanol (16365-27-8) |
화학적 성질
Light yellow solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 기존화학 물질 | KE-26014 |
| F 고인화성물질 | 8 |
용도
용도
2-(p-Nitrophenoxy)ethanol is used in preparation of inimer containing azobenzene group for polymerization of N-isopropylacrylamid.