Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-메톡시-6-니트로-페닐아민
2-메톡시-6-니트로-페닐아민 · 2-METHOXY-6-NITROANILINE · 2-amino-3-nitroanisole · Einecs 240-617-4 · 6-nitro-o-anisidine · Methoxy-6-nitroaniline · 2-Nitro-6-(methoxy)aniline · 2-methoxy-6-nitrobenzenamine
식별자 및 물리적 특성
| CAS No. | 16554-45-3 |
|---|---|
| 분자식 | C7H8N2O3 |
| 평균 분자량 | 168.15 g/mol |
| 단동위원소 질량 | 168.05349212 g/mol |
| SMILES | COc1cccc([N+](=O)[O-])c1N |
| InChIKey | NDKWDGCTUOOAPF-UHFFFAOYSA-N |
| PubChem CID | 85491 |
| EC No. | 240-617-4 |
| DTXSID | DTXSID20167962 |
| 현지명 | 2-메톡시-6-니트로-페닐아민 |
화학 및 물리적 성질
| XLogP | 0.7 |
|---|---|
| 극성 표면적 | 81.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 169 |
| 녹는점 | 73-78℃ |
| 끓는 점 | 322.1±22.0 °C(Predicted) |
| 밀도 | 1.318±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -0.35±0.25(Predicted) |
| 색상 | 밝은 노란색에서 갈색까지 |
| InChI | 1S/C7H8N2O3/c1-12-6-4-2-3-5(7(6)8)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | NDKWDGCTUOOAPF-UHFFFAOYSA-N |
| SMILES | NC1=C([N+]([O-])=O)C=CC=C1OC |
안전 및 규제
| GHS 분류 | DangerH301 (50%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (50%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 2921420090 |
| 포장분류 | Ⅲ |
| 위험 등급 | 6.1Acute Tox. 3 Oral |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
2-Methoxy-6-nitroaniline is useful for preparing pyrimidine derivatives as FGFR4 inhibitors.