Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-나프틸아세토니트릴
1-나프틸아세토니트릴 · ANNAFOMINA · 1-NAPHTHALENEACETO · 1-Naphthyl acetonitr · 1-Naphtylacetonitrile · 1-phthyl acetonitrile · LABOTEST-BB LTBB001326 · a-naphthylacetonitrile
식별자 및 물리적 특성
| CAS No. | 132-75-2 |
|---|---|
| 분자식 | C12H9N |
| 평균 분자량 | 167.21 g/mol |
| 단동위원소 질량 | 167.07349929 g/mol |
| SMILES | N#CCc1cccc2ccccc12 |
| InChIKey | OQRMWUNUKVUHQO-UHFFFAOYSA-N |
| PubChem CID | 8596 |
| EC No. | 205-078-1 |
| DTXSID | DTXSID3059630 |
| 현지명 | 1-나프틸아세토니트릴 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 212 |
| SpringerMaterials Properties | Surface tension |
| 녹는점 | 33-35 °C(lit.) |
| 끓는 점 | 191-194 °C18 mm Hg(lit.) |
| 밀도 | 1.1110 (rough estimate) |
| 굴절률 | n20/D 1.6192(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 디클로로메탄(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 녹은 후에 액체 |
| 색상 | 투명한 노란색에서 갈색까지 |
| BRN | 1101012 |
| InChI | InChI=1S/C12H9N/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8H2 |
| InChIKey | OQRMWUNUKVUHQO-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=C2C(C=CC=C2)=CC=C1 |
| NIST | 1-Naphthaleneacetonitrile(132-75-2) |
| EPA | 1-Naphthaleneacetonitrile (132-75-2) |
화학적 성질
White to yellow solid or melt. Insoluble in water.
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 4% (2 of 50) of reports.WarningH302 (92%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 31-05-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/26186 |
| Hazard Classes and Categories | Acute Tox. 4 (92%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | AM1240000 |
| 운송 번호(UN) | 3276 |
| 독성 | mouse,LD50,intravenous,180mg/kg (180mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#03835, |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-36/37/38-22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-37/39-24/25-37-36 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
용도
용도
2-(Naphthalen-1-yl)acetonitrile is useful for the preparation of tert-Bu benzoates.
제조 및 합성 방법
제조 방법
Synthesis of 1-naphthylacetonitrile: 695g of 1-chloromethyl naphthalene, 1500ml of methanol and 475ml of water, 350g of sodium cyanide mixture boiling reflux, stirring the reaction for 2h. 1300ml of methanol was evaporated, cooled, and the reactants were washed with water to neutral to obtain 670-680g of 1-naphthylacetonitrile.