Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Lysine, DL-
H-DL-LYS-OH · DL-LYSINE BASE · DL-Lysin · DL-LYSINE · rac-Lysine · Lysine,DL- · (RS)-Lysine · Lysine (9CI)
식별자 및 물리적 특성
| CAS No. | 70-54-2 |
|---|---|
| 분자식 | C6H14N2O2 |
| 평균 분자량 | 146.19 g/mol |
| 단동위원소 질량 | 146.10552769 g/mol |
| SMILES | NCCCCC(N)C(=O)O |
| InChIKey | KDXKERNSBIXSRK-UHFFFAOYSA-N |
| PubChem CID | 866 |
| ChEMBL | CHEMBL28328 |
| ChEBI | CHEBI:25094 |
| EC No. | 200-740-6 |
| DTXSID | DTXSID90859004 |
화학 및 물리적 성질
| XLogP | -3 |
|---|---|
| 극성 표면적 | 89.3 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 106 |
| 녹는점 | 170 °C (dec.)(lit.) |
| 끓는 점 | 265.81°C (rough estimate) |
| 밀도 | 1,12 g/cm3 |
| 굴절률 | 1.4650 (estimate) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 용해도 | 메탄올(약간 용해됨), 물(약간 용해됨) |
| pKa(산도 계수) | 2.49±0.24(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 옅은 노란색에서 밝은 베이지색까지 |
| 냄새 | 냄새 없는 |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
| InChIKey | KDXKERNSBIXSRK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(CCCCN)N |
| LogP(분배 계수) | -2.99 |
| NIST | DL-Lysine(70-54-2) |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 100% (200 of 200) of all reports.Not ClassifiedAggregated GHS information provided per 200 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 29-05-2013 https://echa.europa.eu/registration-dossier/-/registered-dossier/7099 |
| Hazard Classes and Categories | Not Classified |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29224110 |
| 안전 문구(S) | 24/25 |
| 기존화학 물질 | KE-22659 |
| F 고인화성물질 | 3-10 |
용도
용도
DL-Lysine is a racemic mixture of the D and L enantiomers of lysine amino acid. Used in the synthesis of proteins, alkaloids and other chemical compounds. Used as a precursor in biosynthesis of Marcfortine A.