Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Acridine Yellow
ACRIDINE YELLOW G · H 107 · CI 46025 · CI NO 46025 · basicyellowk · Acriflavine G · DIAMONDPHOSPHIN · ACRIDINE YELLOW
식별자 및 물리적 특성
| CAS No. | 135-49-9 |
|---|---|
| 분자식 | C15H15N3.ClH |
| 평균 분자량 | 273.76 g/mol |
| 단동위원소 질량 | 273.10327519 g/mol |
| SMILES | Cc1cc2cc3cc(C)c(N)cc3nc2cc1N.Cl |
| InChIKey | BGLGAKMTYHWWKW-UHFFFAOYSA-N |
| PubChem CID | 8672 |
| ChEMBL | CHEMBL1985453 |
| EC No. | 205-194-2 |
| DTXSID | DTXSID2059649 |
화학 및 물리적 성질
| 극성 표면적 | 64.9 |
|---|---|
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 278 |
| 녹는점 | 400 °C |
| 저장 조건 | room temp |
| 용해도 | water: 1 mg/mL, clear, yellow to orange |
| pKa(산도 계수) | pKa -3.0(H2O T=room temperature(RT) Iunspecied) (Uncertain)0.5(H2O T=room temperature(RT) Iunspecied) (Uncertain)8.9(H2O T=room temperature(RT) Iunspecied) (Uncertain) |
| 물리적 상태 | crystalline powder |
| 색상 | 진한 오렌지색에서 갈색의 결정성 분말 |
| 용해도 | water: 1mg/mL, clear, yellow to orange |
| 주요 응용 | 진단 검사 제조혈액학조직학 |
| InChI | 1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16/h3-7H,16-17H2,1-2H31H |
| InChIKey | BGLGAKMTYHWWKW-UHFFFAOYSA-N |
| SMILES | Cl[H].Cc1cc2cc3cc(C)c(N)cc3nc2cc1N |
| EPA | 3,6-Acridinediamine, 2,7-dimethyl-, monohydrochloride (135-49-9) |
화학적 성질
copper or brown-red crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 3,6-Acridinediamine, 2,7-dimethyl-, monohydrochloride3,6-Acridinediamine, 2,7-dimethyl-, monohydrochloride: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Acute Tox. 4 (97.5%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | AR8790000 |
| 관세 코드 | 32041300 |
| 위험 문구(R) | 68-36/37/38-20/21/22-40 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36/37/39-26-36 |
| 위험 등급 | Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralCarc. 2Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |