Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-아미노-6-(메틸설포닐)벤조티아졸
2-아미노-6-(메틸설포닐)벤조티아졸 · 2-AMINO-6-(METHYLSULFONYL)BENZOTHIAZOLE · SKA 16 · AURORA 8319 · AKOS BBS-00006406 · TbPTR1 inhibitor 2 · LABOTEST-BB LT00080641 · Pramipexole Impurity 33
식별자 및 물리적 특성
| CAS No. | 17557-67-4 |
|---|---|
| 분자식 | C8H8N2O2S2 |
| 평균 분자량 | 228.3 g/mol |
| 단동위원소 질량 | 228.0027195 g/mol |
| SMILES | CS(=O)(=O)c1ccc2nc(N)sc2c1 |
| InChIKey | ZYHNHJAMVNINSY-UHFFFAOYSA-N |
| PubChem CID | 87152 |
| ChEMBL | CHEMBL432942 |
| EC No. | 241-537-2 |
| DTXSID | DTXSID4051796 |
| 현지명 | 2-아미노-6-(메틸설포닐)벤조티아졸 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 110 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 312 |
| 녹는점 | 223 °C (dec.)(lit.) |
| 끓는 점 | 500.8±56.0 °C(Predicted) |
| 밀도 | 1.518±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C, protect from light |
| pKa(산도 계수) | 1.99±0.10(Predicted) |
| 물리적 상태 | Solid |
| 색상 | White to off-white |
| EPA | 2-Benzothiazolamine, 6-(methylsulfonyl)- (17557-67-4) |
화학적 성질
white to light yellow powde
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DL0863408 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 독성 | mouse,LD50,intraperitoneal,50mg/kg (50mg/kg),BEHAVIORAL: EXCITEMENTBEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)BEHAVIORAL: ATAXIA,National Technical Information Service. Vol. OTS0534339, |
| 관세 코드 | 2934208090 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36-36/37/39-22 |
| 포장분류 | Ⅲ |
| 위험 등급 | 6.1 |