Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-chloro-1H-indole-2,3-dione
CL039 · oroisatin · NSC 135811 · 5-choroisatin · 5-Chlorisatin · 5-CHLOROISATIN · 5-CHLORISATIDE · AURORA KA-5424
식별자 및 물리적 특성
| CAS No. | 17630-76-1 |
|---|---|
| 분자식 | C8H4ClNO2 |
| 평균 분자량 | 181.57 g/mol |
| 단동위원소 질량 | 180.99305605 g/mol |
| SMILES | O=C1Nc2ccc(Cl)cc2C1=O |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| PubChem CID | 87203 |
| ChEMBL | CHEMBL327012 |
| ChEBI | CHEBI:149904 |
| EC No. | 241-614-0 |
| DTXSID | DTXSID00170111 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 46.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 241 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 254-258 °C (lit.) |
| 밀도 | 1.3743 (rough estimate) |
| 굴절률 | 1.5560 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 8.65±0.20(Predicted) |
| 물리적 상태 | 가루 |
| 용해도 | 불용성 |
| BRN | 383759 |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C(=O)C1=O |
화학적 성질
pale yellow to reddish or yellow-brownish powder
안전 및 규제
| GHS 분류 | WarningH315 (97.7%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.7%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
5-Chloroisatin is a reagent used in the synthesis of Schiff bases through the reaction with 2-methyl-4-nitroaniline or 4-amino-4,5-dihydro-1H-1,2,3-triazole-5-one.
일반 설명
5-Chloroisatin reacts with substituted 4-amino-4,5-dihydro-1H-1,2,4-triazole-5-ones to yield Schiff bases.