Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Undecanoyl chloride
Nsc 83585 · Einecs 241-741-1 · Undecane chloride · Undecanoyl chlorid · UNDECANOYL CHLORIDE · Undercanoyl chloride · HENDECANOYL CHLORIDE · UNDECANOYLE CHLORIDE
식별자 및 물리적 특성
| CAS No. | 17746-05-3 |
|---|---|
| 분자식 | C11H21ClO |
| 평균 분자량 | 204.73 g/mol |
| 단동위원소 질량 | 204.12809297 g/mol |
| SMILES | CCCCCCCCCCC(=O)Cl |
| InChIKey | JUKPJGZUFHCZQI-UHFFFAOYSA-N |
| PubChem CID | 87287 |
| EC No. | 241-741-1 |
| DTXSID | DTXSID4066258 |
화학 및 물리적 성질
| XLogP | 4.6 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 123 |
| 끓는 점 | 135-136 °C/20 mmHg (lit.) |
| 밀도 | 0.93 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.443(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | −20°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 투명한 액체 |
| 비중 | 0.93 |
| 색상 | Colorless to Light yellow to Light orange |
| BRN | 1759226 |
| 안정성 | 수분에 민감한 |
| InChI | InChI=1S/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3 |
| InChIKey | JUKPJGZUFHCZQI-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCCCCCCC |
| EPA | Undecanoyl chloride (17746-05-3) |
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 16-03-2023 https://echa.europa.eu/registration-dossier/-/registered-dossier/16825 |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 관세 코드 | 2915 90 70 |
| 위험 문구(R) | 14-34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| F 고인화성물질 | 10-19-21 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Undecanoyl chloride has been used in the synthesis of:chrysotrione B, 2-acylcyclopentene-1,3-dione derivative, isolated from the fruiting bodies of the basidiomycete Hygrophorus chrysodon2-methylpentadecan-5-one4-ketotetradecanoic acid