Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Diphenylvinylethoxysilane
Einecs 241-870-3 · Vinylethoxydiphenylsilane · ETHOXYDIPHENYLVINYLSILANE · VINYLDIPHENYLETHOXYSILANE · Diphenylvinylethoxysilane · ethenylethoxydiphenyl-silan · ethenylethoxydiphenyl-Silane · Silane,ethenylethoxydiphenyl-
식별자 및 물리적 특성
| CAS No. | 17933-85-6 |
|---|---|
| 분자식 | C16H18OSi |
| 평균 분자량 | 254.4 g/mol |
| 단동위원소 질량 | 254.11269173 g/mol |
| SMILES | C=C[Si](OCC)(c1ccccc1)c1ccccc1 |
| InChIKey | GGJQEMXRDJPGAH-UHFFFAOYSA-N |
| PubChem CID | 87366 |
| EC No. | 241-870-3 |
| DTXSID | DTXSID6066282 |
화학 및 물리적 성질
| 극성 표면적 | 9.2 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 234 |
| 녹는점 | <0°C |
| 끓는 점 | 148 °C5 mm Hg(lit.) |
| 밀도 | 1.017 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.553(lit.) |
| 인화점 | >230 °F |
| 비중 | 1.052 |
| EPA | Silane, ethenylethoxydiphenyl- (17933-85-6) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 기존화학 물질 | KE-13356 |