Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Disiloxane, 1,3-bis(3-chloropropyl)-1,1,3,3-tetramethyl-
1,3-BIS(3-CHLOROPROPYL)-1,1,3,3-TETRAMETHYLDISILOXANE · Disiloxane,1,3-bis(3-chloropropyl)-1,1,3,3-tetramethyl- · Tetramethyldichloropropyldisiloxane · BIS(3-CHLOROPROPYL)TETRAMETHYLDISILOXANE · 1,3-BIS(CHLOROPROPYL)TETRAMETHYLDISILOXANE · 1,3-Bis(3-chloropropyl)tetramethyldisiloxane · 1,3-Bis(3-chlorpropyl)-1,1,3,3-tetramethyldisiloxan · 1,3-bis(3-chloropropyl)-1,1,3,3-tetramethyl-disiloxan
식별자 및 물리적 특성
| CAS No. | 18132-72-4 |
|---|---|
| 분자식 | C10H24Cl2OSi2 |
| 평균 분자량 | 287.37 g/mol |
| 단동위원소 질량 | 286.07427381 g/mol |
| SMILES | C[Si](C)(CCCCl)O[Si](C)(C)CCCCl |
| InChIKey | OILWIZSTLQQEBD-UHFFFAOYSA-N |
| PubChem CID | 87463 |
| EC No. | 242-018-3 |
| DTXSID | DTXSID1066314 |
화학 및 물리적 성질
| 극성 표면적 | 9.2 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 157 |
| 끓는 점 | 128 °C |
| 밀도 | 0.996 |
| 굴절률 | 1.4484 [25°C] |
| 인화점 | 92°C |
| 저장 조건 | 2-8°C |
| 비중 | 0.996 |
| EPA | Disiloxane, 1,3-bis(3-chloropropyl)-1,1,3,3-tetramethyl- (18132-72-4) |
화학적 성질
Colorless or yellowish transparent liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: Disiloxane, 1,3-bis(3-chloropropyl)-1,1,3,3-tetramethyl- |
| TSCA 등재 상태 | TSCA listed |
| 위험 문구(R) | 36/37/38 |
| 안전 문구(S) | 26-36/37/39 |