Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(2-히드록시페닐)-(4-메톡시페닐)메탄온
(2-히드록시페닐)-(4-메톡시페닐)메탄온 · (2-hydroxyphenyl)-(4-methoxyphenyl)methanone · Methanone, (2-hydroxyphenyl)(4-methoxyphenyl)-
식별자 및 물리적 특성
| CAS No. | 18733-07-8 |
|---|---|
| 분자식 | C14H12O3 |
| 평균 분자량 | 228.24 g/mol |
| 단동위원소 질량 | 228.07864424 g/mol |
| SMILES | COc1ccc(C(=O)c2ccccc2O)cc1 |
| InChIKey | MPOIUZCYWIPYNC-UHFFFAOYSA-N |
| PubChem CID | 87768 |
| DTXSID | DTXSID30172042 |
| 현지명 | (2-히드록시페닐)-(4-메톡시페닐)메탄온 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 256 |
안전 및 규제
| 규제 정보 | Chemical: Methanone, (2-hydroxyphenyl)(4-methoxyphenyl)- |
|---|---|
| 기타 안전 정보 | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
제조 및 합성 방법
제조 방법
Preparation from 2-iodophenyl p-anisate on treatment with n-butyllithium in a mixture of ethyl ether, hexane and tetrahydrofuran at 70° for 2 h, followed by treatment with saturated aqueous ammonium chloride (<18%).