Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디플로로벤질알코올(2,6-)
디플로로벤질알코올(2,6-) · 2,6-다이플루오로벤질 알코올 · 2,6-Difluorobenzyl · 2,6-Difluorbenzyl · RufimideImpurity10 · RARECHEM AL BD 0212 · 2,6-Difluorobenzyl a · Lufeamide Impurity 9
식별자 및 물리적 특성
| CAS No. | 19064-18-7 |
|---|---|
| 분자식 | C7H6F2O |
| 평균 분자량 | 144.12 g/mol |
| 단동위원소 질량 | 144.03867125 g/mol |
| SMILES | OCc1c(F)cccc1F |
| InChIKey | LVICICZQETYOGS-UHFFFAOYSA-N |
| PubChem CID | 87921 |
| EC No. | 242-792-2 |
| DTXSID | DTXSID40172558 |
| 현지명 | 디플로로벤질알코올(2,6-) |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 97.8 |
| LogP(분배 계수) | 1.12 |
| 녹는점 | 168.5-169 °C |
| 끓는 점 | 88 °C |
| 밀도 | 1.3 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.495(lit.) |
| 인화점 | 192 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 투명한 액체 |
| pKa(산도 계수) | 13.41±0.10(Predicted) |
| 색상 | Colorless to Light yellow to Light orange |
| 비중 | 1.300 |
| 용해도 | 물에 섞이거나 혼합하기 어렵지 않습니다. |
| BRN | 2501536 |
| InChI | InChI=1S/C7H6F2O/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 |
| InChIKey | LVICICZQETYOGS-UHFFFAOYSA-N |
| SMILES | C1(CO)=C(F)C=CC=C1F |
| NIST | 2,6-Difluorobenzyl alcohol(19064-18-7) |
화학적 성질
clear colorless to light yellow liquid
안전 및 규제
| GHS 분류 | WarningH302 (38.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 18 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzenemethanol, 2,6-difluoro-Status: Active Update: 10-08-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/19406 |
| Hazard Classes and Categories | Acute Tox. 4 (38.9%) |
| 수질 위해 등급(WGK) | 1 |
| 관세 코드 | 2906290090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-37/39 |
| 위험 등급 | IRRITANT |
| 기존화학 물질 | 2013-3-5651 |
용도
용도
2,6-Difluorobenzyl alcohol is used to get 2-(bromomethyl)-1,3-difluorobenzene.