시트랄
시트랄 · 게라니알(트랜스시트랄) · 2,6-옥타다이엔알, 3,7-다이메틸- · NERAL · GERANIAL · cis-Citral · 2,6-Octadienal, 3,7-dimethyl- · 3,7-DIMETHYL-2,6-OCTADIENAL
식별자 및 물리적 특성
| CAS No. | 5392-40-5 |
|---|---|
| 분자식 | C10H16O |
| 평균 분자량 | 152.23 g/mol |
| 단동위원소 질량 | 152.12011513 g/mol |
| SMILES | CC(C)=CCCC(C)=CC=O |
| InChIKey | WTEVQBCEXWBHNA-UHFFFAOYSA-N |
| PubChem CID | 8843 |
| ChEMBL | CHEMBL2297541 |
| ChEBI | CHEBI:23316 |
| DTXSID | DTXSID6024836 |
| 현지명 | 시트랄 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 171 |
| SpringerMaterials Properties | Boiling point |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | <-10°C |
| 끓는 점 | 229 °C (lit.) |
| 밀도 | 0.888 g/mL at 25 °C (lit.) |
| 증기 밀도 | 5 (vs air) |
| 증기압 | 0.2 mm Hg ( 200 °C) |
| 굴절률 | n20/D 1.488(lit.) |
| FEMA | 2303 | CITRAL |
| 인화점 | 215 °F |
| 저장 조건 | 2-8°C |
| 용해도 | 0.42g/L |
| 물리적 상태 | 액체 |
| 색상 | 무색~연황색 |
| 냄새 | 100.00%에서. 달콤한 레몬 시트랄 |
| 향취 유형 | 감귤류 |
| 생물학적 소스 | synthetic |
| 폭발한계 | 4.3-9.9%(V) |
| 용해도 | 실질적으로 불용성 |
| Merck | 14,2322 |
| JECFA Number | 1225 |
| BRN | 1721871 |
| 헨리 상수 | 2.9×10-1 mol/(m3Pa) at 25℃, Wu et al. (2022) |
| 안정성 | 안정적인. 그러나 쉽게 이성질체화됩니다. 알칼리, 강산화제, 강산과 호환되지 않습니다. 타기 쉬운. 공기와 빛에 민감합니다. |
| 주요 응용 | 향료 및 향 |
| 화장품 원료 기능 | 향료향기향수 |
| InChI | 1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | WTEVQBCEXWBHNA-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C=C(C)CC\C=C(\C)C |
| LogP(분배 계수) | 2.76 at 25℃ |
| NIST | Citral(5392-40-5) |
| EPA | Citral (5392-40-5) |
화학적 성질
Citral occurs as (2Z)- and (2E)-isomers (citral a and b, respectively) analogous to the corresponding alcohols, geraniol and nerol: geranial (citral a), bp2.7 kPa 118–119 °C, d20 0.8888, n20 D 1.4898; neral (citral b), bp2.7 kPa 120 °C, d20 0.8869, n20 D 1.4869. Natural citral is nearly always a mixture of the two isomers. It occurs in lemongrass oil (up to 85%), in Litsea cubeba oil (up to 75%), and in small amounts inmany other essential oils. The citrals are colorless to slightly yellowish liquids, with an odor reminiscent of lemon. Since citral is an α,β-unsaturated aldehyde with an additional double bond, it is highly reactive and may undergo reactions such as cyclization and polymerization. Geraniol, citronellol, and 3,7-dimethyloctan-l-ol can be obtained from citral by stepwise hydrogenation. Citral can be converted into a number of addition compounds; the (Z)- and (E)-isomers can be separated via the hydrogen sulfite addition compounds.The condensation of citral with active methylene groups is used on an industrial scale in the synthesis of pseudoionones, which are starting materials for ionones and vitamins.
안전 및 규제
| 수질 위해 등급(WGK) | 1 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | RG5075000 |
| 운송 번호(UN) | 1760 |
| 독성 | LD50 orally in rats: 4.96 g/kg (Opdyke) |
| 관세 코드 | 2912 19 00 |
| 위험 문구(R) | 38-43 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25-37 |
| 포장분류 | III |
| 위험 등급 | 8Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 |
| 기존화학 물질 | KE-11579 |
| 자연 발화 온도 | 225 °C |
| 저장 분류 | 10 - Combustible liquids |
| 유해 물질 데이터 | 5392-40-5(Hazardous Substances Data) |
용도
출처
Reported found in apricot, clary sage, ginger, grape, grapefruit, lemon, lime, mandarin, orange, raspberry, tamarind, tangerine, tea and tomato.
용도
Citral is an anti-microbial agent found in plants with antibacterial activity against some food pathogens. It is also a fragrance compound with a distinct lemon scent.
일반 설명
A clear yellow colored liquid with a lemon-like odor. Less dense than water and insoluble in water. Toxic by ingestion. Used to make other chemicals.