피틱산
피틴산 · 피틱산 · 파이틱애씨드 · INOSITOL HEXAPHOSPHATE · phytic · phyticacidsolution · myo-Inositol hexakisphosphate · alkovert
식별자 및 물리적 특성
| CAS No. | 83-86-3 |
|---|---|
| 분자식 | C6H18O24P6 |
| 평균 분자량 | 660.04 g/mol |
| 단동위원소 질량 | 659.86137342 g/mol |
| SMILES | O=P(O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
| InChIKey | IMQLKJBTEOYOSI-UHFFFAOYSA-N |
| PubChem CID | 890 |
| ChEMBL | CHEMBL2005481 |
| ChEBI | CHEBI:17401 |
| DTXSID | DTXSID00861653 |
| 현지명 | 피틱산 |
화학 및 물리적 성질
| XLogP | -10.3 |
|---|---|
| 극성 표면적 | 401 |
| 수소 결합 공여자 수 | 12 |
| 수소 결합 수용자 수 | 24 |
| 회전 가능 결합 수 | 12 |
| 무거운 원자 수 | 36 |
| 형식 전하 | 0 |
| 복잡도 | 818 |
| Collision Cross Section | 215.8 Ų [M+H]+ [CCS Type: DTMethod: single field calibrated with ESI Low Concentration Tuning Mix (Agilent)]195.4 Ų [M-H]- [CCS Type: DT201.3 Ų [M+Na-2H]- [CCS Type: DT193.29 Ų [M-H]- [CCS Type: DTMethod: single field calibrated with Agilent tune mix (Agilent)]215.5 Ų [M+H]+195.5 Ų [M-H]-201 Ų [M-2H+Na]- |
| 녹는점 | <25℃ |
| 끓는 점 | 105 °C |
| 밀도 | 1.432 g/mL at 25 °C |
| 증기압 | 0.039Pa at 60℃ |
| 굴절률 | n20/D 1.4 |
| 저장 조건 | 2-8°C |
| 용해도 | Acetone (Slightly), Methanol (Slightly), Water (Soluble) |
| 물리적 상태 | Colourless to Light Brown Solution |
| pKa(산도 계수) | 1.13±0.10(Predicted) |
| 비중 | 1.282 |
| 색상 | Colorless to light yellow |
| 냄새 | 냄새 없는 |
| 용해도 | 혼용 가능 |
| Merck | 14,7387 |
| BRN | 2201952 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 화장품 원료 기능 | 킬레이팅 |
| InChIKey | IMQLKJBTEOYOSI-GPIVLXJGSA-N |
| SMILES | OP(O)(=O)O[C@@H]1[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| EPA | myo-Inositol, hexakis(dihydrogen phosphate) (83-86-3) |
화학적 성질
colourless to pale yellow liquid
안전 및 규제
| 수질 위해 등급(WGK) | - |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | NM7525000 |
| 운송 번호(UN) | 1760 |
| 독성 | LD50 intravenous in mouse: 500mg/kg |
| 관세 코드 | 29199000 |
| 위험 문구(R) | 36/37/38-35 |
| 위험 표시 | Xi,C |
| 안전 문구(S) | 26-36-37/39-45-36/37/39 |
| 포장분류 | III |
| 위험 등급 | 8Acute Tox. 4 OralEye Dam. 1Met. Corr. 1Skin Corr. 1 |
| 기존화학 물질 | KE-21019 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
금속킬레이트제,부식방부제.
용도
The principal storage form of phosphorus in many plant tissues, especially bran and seeds. It has antioxidant effect as well as neuroprotective effect by chelating iron. Inositol hexakisphosphate kina se type 2 (InsP6K2), which converts phytic acid to inositol pyrophosphate diphosphoinositol pentakisphosphate, is believed to induce pathogenesis of Huntington disease (HD).
일반 설명
Phytic acid is a mineral chelator that can bind to minerals to form mineral-phytate complex.It can also complex with metal ions bound to the surface of magnesium alloy to form a conversion coating, which can improve the resistance of magnesium alloy towards corrosion.