Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-디브로모-2,2,6,6-테트라메틸-4-피페리돈하이드로브로마이드
3,5-디브로모-2,2,6,6-테트라메틸-4-피페리돈하이드로브로마이드 · 3,5-dibromo-2,2,6,6-tetramethyl-4-piperidone hydrobromide · 3,5-DibroMo-2,2,6,6-tetraMethyl-4-piperidinone HydrobroMide · 3,5-DibroMo-4-oxo-2,2,6,6-tetraMethylpiperidine HydrobroMide
식별자 및 물리적 특성
| CAS No. | 19971-12-1 |
|---|---|
| 분자식 | C9H16Br3NO |
| 평균 분자량 | 393.94 g/mol |
| 단동위원소 질량 | 390.8782 g/mol |
| SMILES | Br.CC1(C)NC(C)(C)C(Br)C(=O)C1Br |
| InChIKey | VMHVSXXACDJVRL-UHFFFAOYSA-N |
| PubChem CID | 89251 |
| EC No. | 243-446-3 |
| DTXSID | DTXSID50885107 |
| 현지명 | 3,5-디브로모-2,2,6,6-테트라메틸-4-피페리돈하이드로브로마이드 |
화학 및 물리적 성질
| 극성 표면적 | 29.1 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 216 |
| 용해도 | 에 용해됨DMSO, 물 |
| 물리적 상태 | 고체 |
| 색상 | 회백색 |
| EPA | 4-Piperidinone, 3,5-dibromo-2,2,6,6-tetramethyl-, hydrobromide (19971-12-1) |
화학적 성질
Off-White Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposureRespiratory tract irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%)Eye Irrit. 2 (100%)STOT SE 3 (100%) |
| TSCA 등재 상태 | TSCA listed |
용도
용도
3,5-dibromo-2,2,6,6-tetramethyl-4-piperidone hydrobromide can be used as a useful synthetic intermediate.