Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-클로로-2-[(2,2,2-트리플루오로에틸)아미노]벤조페논
5-클로로-2-[(2,2,2-트리플루오로에틸)아미노]벤조페논 · Einecs 245-199-7 · 5-chloro-2-[(2,2,2-trifluoroethyl)amino]benzophenone · 2-[N-(2,2,2-Trifluoroethyl)amino]-5-chlorobenzophenone · [5-Chloro-2-[(2,2,2-trifluoroethyl)amino]phenyl]phenyl ketone · [5-chloro-2-(2,2,2-trifluoroethylamino)phenyl]-phenylmethanone · Methanone, [5-chloro-2-[(2,2,2-trifluoroethyl)amino]phenyl]phenyl-
![5-클로로-2-[(2,2,2-트리플루오로에틸)아미노]벤조페논 분자 구조식](/img/chemical/89821.png)
식별자 및 물리적 특성
| CAS No. | 22753-80-6 |
|---|---|
| 분자식 | C15H11ClF3NO |
| 평균 분자량 | 313.7 g/mol |
| 단동위원소 질량 | 313.0481262 g/mol |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NCC(F)(F)F |
| InChIKey | MKBQTVZIYPYTSC-UHFFFAOYSA-N |
| PubChem CID | 89821 |
| EC No. | 245-199-7 |
| DTXSID | DTXSID40177301 |
| 현지명 | 5-클로로-2-[(2,2,2-트리플루오로에틸)아미노]벤조페논 |
화학 및 물리적 성질
| XLogP | 5.5 |
|---|---|
| 극성 표면적 | 29.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 355 |
| Kovats Retention Index | 196819752000 |
| 녹는점 | 99-100 °C |
| 끓는 점 | 435.2±45.0 °C(Predicted) |
| 밀도 | 1.353±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | -1.38±0.50(Predicted) |
| 주요 응용 | 의약품(소분자) |
| InChI | 1S/C15H11ClF3NO/c16-11-6-7-13(20-9-15(17,18)19)12(8-11)14(21)10-4-2-1-3-5-10/h1-8,20H,9H2 |
| InChIKey | MKBQTVZIYPYTSC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CNc1c(cc(cc1)Cl)C(=O)c2ccccc2 |
안전 및 규제
| 수질 위해 등급(WGK) | WGK 3 |
|---|---|
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-(2,2,2-Trifluoroethylamino)-5-chlorobenzophenone is a benzophenone derivative with the potential to act as a photo-initiator in applications involving the prevention of UV light damage on polymer films.