식별자 및 물리적 특성
| CAS No. | 24556-65-8 |
|---|
| 분자식 | C13H8Br3NO2 |
|---|
| 평균 분자량 | 449.92 g/mol |
|---|
| 단동위원소 질량 | 446.81052 g/mol |
|---|
| SMILES | O=C(Nc1ccccc1)c1cc(Br)c(Br)c(Br)c1O |
|---|
| InChIKey | WLYIIDKKPCXCLS-UHFFFAOYSA-N |
|---|
| PubChem CID | 90539 |
|---|
| EC No. | 246-311-7 |
|---|
| DTXSID | DTXSID90179294 |
|---|
화학 및 물리적 성질
| XLogP | 5 |
|---|
| 극성 표면적 | 49.3 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 19 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 323 |
|---|
| 물질 분류 | Other Classes -> Halogenated Salicylanilides |
|---|
안전 및 규제
| 유해성 요약 | The halogenated salicylanilides may cause photoallergic contact dermatitis (PACD). Patients with PACD note the appearance of a eczematous rash, usually on the face, neck, dorsum of the hands, and sun-exposed areas on the arms with sparing of areas under the chin and upper eyelids. [LaDou, p. 334] |
|---|
| 유해 작용 | Dermatotoxin - PACD (photoallergic contact dermatitis). |
|---|
