Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Bromo-2,6-xylidine
4-BROMO-2,6-XYLIDINE · 2,6-Dimethyl-4-bromoaniline · 4-Bromo-2,6-dimethyl-phenylamine · 6-diMethylaniline · TIMTEC-BB SBB002410 · 4-Bromo-2,6-dimethyl · LABOTEST-BB LT01143222 · 2,6-Xylidine, 4-bromo-
식별자 및 물리적 특성
| CAS No. | 24596-19-8 |
|---|---|
| 분자식 | C8H10BrN |
| 평균 분자량 | 200.08 g/mol |
| 단동위원소 질량 | 198.99966142 g/mol |
| SMILES | Cc1cc(Br)cc(C)c1N |
| InChIKey | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| PubChem CID | 90549 |
| EC No. | 246-337-9 |
| DTXSID | DTXSID40179345 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 104 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| 녹는점 | 48-51 °C (lit.) |
| 끓는 점 | 120°C 0,2mm |
| 밀도 | 1.4423 (rough estimate) |
| 굴절률 | 1.5748 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| pKa(산도 계수) | 3.60±0.10(Predicted) |
| 물리적 상태 | 액체 |
| 색상 | 투명한 노란색에서 주황색, 호박색까지 |
| BRN | 1936300 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,10H2,1-2H3 |
| InChIKey | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(Br)C=C1C |
| NIST | Benzenamine, 4-bromo-2,6-dimethyl-(24596-19-8) |
화학적 성질
brown crystals
안전 및 규제
| GHS 분류 | DangerH302 (18.4%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P342+P316, P362+P364, P403, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (18.4%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN2811/6.1/III |
| 관세 코드 | 29214990 |
| 위험 문구(R) | 38-43-36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 36/37-36/37/39-26 |
| 위험 등급 | 6.1Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Carc. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 8-10-23 |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
4-Bromo-2,6-dimethylaniline has been used in the preparation of:4-bromo-N-(1-(6-(1-isopropyl-1H-benzo[d]imidazol-2-yl)pyridin-2-yl)ethylidene)-2,6-dimethylbenzenamineN-(4-Bromo-2,6-dimethylphenyl)-5-trimethylammoniumsalicylaldimine chlorideethynyl-functionalized persistent perylene diimide-multichromophore