Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-벤조일-4-피페리돈
N-벤조일-4-피페리돈 · 1-BENZOYL-4-PIPERIDONE · NSC 97564 · N-BENZOYLPIPERIDONE · N-Benzoylpiperidinone · N-BENZOYL-4-PIPERIDONE · 1-Benzoyl-piperidinoine · N-Benzoylpiperidone 98%
식별자 및 물리적 특성
| CAS No. | 24686-78-0 |
|---|---|
| 분자식 | C12H13NO2 |
| 평균 분자량 | 203.24 g/mol |
| 단동위원소 질량 | 203.09462866 g/mol |
| SMILES | O=C1CCN(C(=O)c2ccccc2)CC1 |
| InChIKey | NZAXGZYPZGEVBD-UHFFFAOYSA-N |
| PubChem CID | 90583 |
| EC No. | 246-407-9 |
| DTXSID | DTXSID80179425 |
| 현지명 | N-벤조일-4-피페리돈 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 37.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 246 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 55-59 °C (lit.) |
| 끓는 점 | 158-160 °C/0.2 mmHg (lit.) |
| 밀도 | 1.1255 (rough estimate) |
| 굴절률 | 1.5440 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 염화메틸렌: 가용성 |
| pKa(산도 계수) | -1.45±0.20(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| BRN | 158848 |
| InChI | 1S/C12H13NO2/c14-11-6-8-13(9-7-11)12(15)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | NZAXGZYPZGEVBD-UHFFFAOYSA-N |
| SMILES | O=C1CCN(CC1)C(=O)c2ccccc2 |
화학적 성질
light yellow granular powder or granules
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 50% (1 of 2) of reports.WarningH315 (50%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (50%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333999 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
1-Benzoyl-4-piperidone can be used as starting reagent in the synthesis of fentanyl.