Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 910481생성일: 2026년 11월 3일
Alpha-(4-ethoxyphenylimino)-P-cresol
alpha-(4-Ethoxyphenylimino)-p-cresol · Phenol, 4-[[(4-ethoxyphenyl)imino]methyl]-
https://huagongshe.com/ko/chemical/910481
식별자 및 물리적 특성
| CAS No. | 15484-90-9 |
|---|
| 분자식 | C15H15NO2 |
|---|
| 평균 분자량 | 241.28 g/mol |
|---|
| 단동위원소 질량 | 241.11027872 g/mol |
|---|
| SMILES | CCOc1ccc(N=Cc2ccc(O)cc2)cc1 |
|---|
| InChIKey | MEYXUKYINZWWBO-UHFFFAOYSA-N |
|---|
| PubChem CID | 910481 |
|---|
| EC No. | 665-389-7 |
|---|
| DTXSID | DTXSID001281601 |
|---|
화학 및 물리적 성질
| XLogP | 3.2 |
|---|
| 극성 표면적 | 41.8 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 4 |
|---|
| 무거운 원자 수 | 18 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 251 |
|---|
| 끓는 점 | 420.6±30.0 °C(Predicted) |
|---|
| 밀도 | 1.07±0.1 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 8+-.0.15(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H315 |
|---|
