Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
알파-파이넨 옥사이드
알파-파이넨 옥사이드 · 3-Oxatricyclo[4.1.1.0(2,4)]octane, 2,7,7-trimethyl- · 2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane · Nsc5609 · 2-pineneoxide · α-Epoxypinane · a-PineneOxide · AURORA KA-478
식별자 및 물리적 특성
| CAS No. | 1686-14-2 |
|---|---|
| 분자식 | C10H16O |
| 평균 분자량 | 152.23 g/mol |
| 단동위원소 질량 | 152.12011513 g/mol |
| SMILES | CC1(C)C2CC3OC3(C)C1C2 |
| InChIKey | NQFUSWIGRKFAHK-UHFFFAOYSA-N |
| PubChem CID | 91508 |
| ChEMBL | CHEMBL274511 |
| ChEBI | CHEBI:29060 |
| EC No. | 216-869-6 |
| DTXSID | DTXSID5051781 |
| 현지명 | 알파-파이넨 옥사이드 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 12.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 221 |
| SpringerMaterials Properties | Schoenflies notation |
| LogP(분배 계수) | 2.01 |
| Physical Description | Solid |
| 끓는 점 | 102-103 °C/50 mmHg (lit.) |
| 밀도 | 0.964 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.469(lit.) |
| 인화점 | 150 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 클로로포름(적당), 디클로로메탄(적당), 에탄올(약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 무색 |
| 비중 | 0.97 |
| 헨리 상수 | 2.3×10-2 mol/(m3Pa) at 25℃, Fichan et al. (1999) |
| 안정성 | 수분에 민감한 |
| InChI | 1S/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8,10/m1/s1 |
| InChIKey | NQFUSWIGRKFAHK-BGPATTHWSA-N |
| SMILES | CC1(C)[C@H]2CC3OC3(C)[C@@H]1C2 |
| LogP(분배 계수) | 2.339 (est) |
| EPA | 3-Oxatricyclo[4.1.1.02,4]octane, 2,7,7-trimethyl- (1686-14-2) |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2.8% (1 of 36) of reports.WarningH302 (91.7%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 36 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: 3-Oxatricyclo[4.1.1.02,4]octane, 2,7,7-trimethyl-REACH registered substance: 2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane (EC: 216-869-6)3-Oxatricyclo4.1.1.02,4octane, 2,7,7-trimethyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (91.7%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | TK4565000 |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 2910.90.9100 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
| 기존화학 물질 | 2000-3-1415 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
An industrially important reaction of optically active a-pinene oxide is rearrangement to campholene aldehyde (e.g., in the presence of zinc bromide). Subsequent aldol condensation with lower aliphatic aldehydes or ketones (e.g., propionaldehyde, butyraldehyde, or acetone) provides unsaturated aldehydes or ketones that can be reduced to the corresponding saturated alcohols. These are used in the fragrance industry as a sandalwood scent.
제조 및 합성 방법
제조 방법
a-Pinene oxide is prepared industrially by using percarboxylic acid. Processes based on air oxidation are also known.