하이드록시플루타미드
하이드록시플루타미드 · CS-1970 · utamide · Sch-16423 · Hydroxy FL · Hydroxyflutamid · Hydroxyflutamide · hydroxyniphtholide
식별자 및 물리적 특성
| CAS No. | 52806-53-8 |
|---|---|
| 분자식 | C11H11F3N2O4 |
| 평균 분자량 | 292.21 g/mol |
| 단동위원소 질량 | 292.06709132 g/mol |
| SMILES | CC(C)(O)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| PubChem CID | 91649 |
| ChEMBL | CHEMBL491 |
| EC No. | 641-868-6 |
| DTXSID | DTXSID8033562 |
| 현지명 | 하이드록시플루타미드 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 95.2 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 392 |
| LogP(분배 계수) | 2.7 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 157.4 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID8033562] |
| 녹는점 | 125-130°C |
| 끓는 점 | 443.8±45.0 °C(Predicted) |
| 밀도 | 1.472 |
| 저장 조건 | room temp |
| 용해도 | DMSO: >10mg/mL |
| pKa(산도 계수) | 12.87±0.70(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 황갈색까지 |
| InChI | 1S/C11H11F3N2O4/c1-10(2,18)9(17)15-6-3-4-8(16(19)20)7(5-6)11(12,13)14/h3-5,18H,1-2H3,(H,15,17) |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(=O)Nc1ccc(c(c1)C(F)(F)F)[N+]([O-])=O |
화학적 성질
HYDROXYFLUTAMIDE is Yellow-Brown Powder
안전 및 규제
| GHS 분류 | DangerH302 (55.7%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P260, P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 88 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (55.7%) |
| 건강 영향 | Environmental antiandrogens can have harmful effects on reproductive organ development in fetuses exposed in utero as well as their offspring. (Wikipedia) |
| 독성 요약 | Hydroxyflutamide is an antiandrogen. Antiandrogens alter the androgen pathway by blocking the appropriate receptors, competing for binding sites on the cell's surface, or affecting androgen production. Antiandrogens are classified as steroidal or nonsteroidal. Steroidal antiandrogens not only counter androgens, but also affect secondary sex characteristics. Steroidal antiandrogens directly affect gene expression due to their fat-soluble nature that allows them to diffuse through the plasma membrane's phospholipid bilayer and prevent the binding of testosterone and dihydrotestosterone (DHT) to the androgen receptor. Inhibition of androgen production occurs through a unique mechanism for each antiandrogen. (Wikipedia) |
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | TX1466250 |
| 관세 코드 | 2924297099 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
2-hydroxy Flutamide is the major metabolite formed during the metabolism of the non-steroidal antiandrogen flutamide by cytochrome P450 (CYP) isoforms CYP1A2 and CYP3A4. Through competitive inhibition of the binding of testosterone to the nuclear androgen receptor (AR; IC50 = ~300-900), 2-hydroxy flutamide blocks the expression of AR target genes and prevents androgen-dependent stabilization of the AR. Compared to flutamide, 2-hydroxy flutamide is a more potent antiandrogen in vivo, demonstrating a higher binding affinity for the AR (0.1% binding affinity relative to dihydrotestosterone) and, thus, is the predominant contributor to the therapeutic effects of flutamide in the treatment of prostate cancer.
용도
HYDROXYFLUTAMIDE is used non-steroidal antagonist Flutamide. Shown to be an antianhydrogen.