Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(2-클로로-4-트리플루오로메틸페녹시)벤조산
3-(2-클로로-4-트리플루오로메틸페녹시)벤조산 · Einecs 264-433-9 · 3-(2-Chloro-4-trifluoromethylphenoxy)benzoic acid · 3-[2-chloro-4-(trifluoromethyl)phenoxy]-benzoicaci · 3-(2-chloro-4-(trifluoromethyl)phenoxy)-benzoicaci · benzoicacid,3-(2-chloro-4-(trifluoromethyl)phenoxy)-
식별자 및 물리적 특성
| CAS No. | 63734-62-3 |
|---|---|
| 분자식 | C14H8ClF3O3 |
| 평균 분자량 | 316.66 g/mol |
| 단동위원소 질량 | 316.0114063 g/mol |
| SMILES | O=C(O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChIKey | ONKRUAQFUNKYAX-UHFFFAOYSA-N |
| PubChem CID | 91685 |
| EC No. | 264-433-9 |
| DTXSID | DTXSID4028121 |
| 현지명 | 3-(2-클로로-4-트리플루오로메틸페녹시)벤조산 |
화학 및 물리적 성질
| XLogP | 4.5 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 375 |
| 끓는 점 | 374.0±42.0 °C(Predicted) |
| 밀도 | 1.4411 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 3.92±0.10(Predicted) |
| 헨리 상수 | 6.4×102 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| EPA | Benzoic acid, 3-[2-chloro-4-(trifluoromethyl)phenoxy]- (63734-62-3) |
안전 및 규제
| TSCA 등재 상태 | TSCA listed |
|---|
용도
용도
3-(2-Chloro-4-(trifluoromethyl)phenoxy)benzoic acid can be used in the optimisation study of the aromatic nitration reaction process. Taking the nitration of 3-(2-Chloro-4-(trifluoromethyl)phenoxy)benzoic acid as an example, a continuous-flow mixed-acid aromatic nitration process was developed within a droplet-type microreactor. The effects of key operating parameters were systematically characterised. This process lays the foundation for subsequent production of acifluorfen.