Testosterone, acetate
skf5647 · SKF 5647 · Amolisin · Test Ace · Farmatest · NSC523836 · DEPOSTERON · androtesta
식별자 및 물리적 특성
| CAS No. | 1045-69-8 |
|---|---|
| 분자식 | C21H30O3 |
| 평균 분자량 | 330.5 g/mol |
| 단동위원소 질량 | 330.21949482 g/mol |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChIKey | DJPZSBANTAQNFN-PXQJOHHUSA-N |
| PubChem CID | 92145 |
| ChEMBL | CHEMBL488762 |
| ChEBI | CHEBI:16524 |
| EC No. | 213-876-6 |
| DTXSID | DTXSID80909007 |
화학 및 물리적 성질
| XLogP | 3.9 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 24 |
| 형식 전하 | 0 |
| 복잡도 | 606 |
| 지질 | Lipids -> Sterol Lipids [ST] -> Steroids [ST02] -> C19 steroids (androgens) and derivatives [ST0202] |
| SpringerMaterials Properties | Crystal structure |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 139-141 °C |
| 끓는 점 | 427.89°C (rough estimate) |
| 밀도 | 1.0234 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 인화점 | 2℃ |
| 저장 조건 | Controlled Substance, -20°C Freezer |
| 용해도 | Acetonitrile: 1 mg/mlEthanol: 1 mg/mlMethanol: 1 mg/ml |
| 물리적 상태 | 결정성 고체 |
| 용해도 | 2.35mg/L(25℃) |
| Merck | 13,9255 |
| InChI | InChI=1/C21H30O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h12,16-19H,4-11H2,1-3H3/t16-,17-,18-,19-,20-,21-/s3 |
| InChIKey | DJPZSBANTAQNFN-PXQJOHHUSA-N |
| SMILES | [C@]12([H])CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)CC[C@]21C)OC(=O)C |&1:0,4,6,9,11,21,r| |
| NIST | Androst-4-en-3-one, 17-(acetyloxy)-, (17«beta»)-(1045-69-8) |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P264, P270, P280, P301+P317, P318, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | XA3061500 |
| 운송 번호(UN) | UN 2811 6.1/PG 2 |
| 위험 문구(R) | 45-22-63-36-20/21/22-11 |
| 위험 표시 | T,Xn,F |
| 안전 문구(S) | 53-22-26-36-36/37-16 |
용도
개요
Testosterone acetate is an analytical reference standard categorized as an anabolic androgenic steroid. It is an ester of the naturally occurring androgen, testosterone. Testosterone acetate is regulated as a Schedule III compound in the United States. This product is intended for research and forensic applications.
용도
Testosterone Acetate is a Controlled substance that is less popular due to Acetate solution, which is aqueous solution, instead of oil solution as other esterified versions of testosterone that is offering much longer half life. It does not have any medical uses when it comes with Acetate ester. However, taken in consideration that it works in the same way as any other esterified testosterone, it can be used for the same purposes as the esterified testosterones.
일반 설명
Testosterone acetate is an androgen ester and an intermediate in the synthesis of testosterone from progesterone, isolated from microorganisms.