Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
6-아자인돌
6-아자인돌 · 1H-Pyrrolo[2,3-c]pyridine · 6-Azaindol · 6-Azaindole · 6-Aza-1H-indole · 6-Azaindole, 98+% · Harmyrine 1,6-Diazaindene · 6-Azaindole,1H-pyrrolo[2,3-c]pyridine
식별자 및 물리적 특성
| CAS No. | 271-29-4 |
|---|---|
| 분자식 | C7H6N2 |
| 평균 분자량 | 118.14 g/mol |
| 단동위원소 질량 | 118.05309819 g/mol |
| SMILES | c1cc2cc[nH]c2cn1 |
| InChIKey | XLKDJOPOOHHZAN-UHFFFAOYSA-N |
| PubChem CID | 9219 |
| ChEMBL | CHEMBL5208607 |
| EC No. | 664-233-5 |
| DTXSID | DTXSID20181562 |
| 현지명 | 6-아자인돌 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 28.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 103 |
| 녹는점 | 136-137°C |
| 끓는 점 | 295.8±13.0 °C(Predicted) |
| 밀도 | 1.242±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 14.66±0.30(Predicted) |
| 용해도 | 물(거의), 메탄올, 클로로포름에 용해됩니다. |
| InChI | InChI=1S/C7H6N2/c1-3-8-5-7-6(1)2-4-9-7/h1-5,9H |
| InChIKey | XLKDJOPOOHHZAN-UHFFFAOYSA-N |
| SMILES | C1=NC=CC2C=CNC1=2 |
화학적 성질
crystals
안전 및 규제
| GHS 분류 | DangerH302 (92.2%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (92.2%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 독성 | mouse,LD50,intraperitoneal,12mg/kg (12mg/kg),Journal of Medicinal Chemistry. Vol. 6, Pg. 480, 1963. |
| 관세 코드 | 29339980 |
| 위험 표시 | Xi |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
6-Azaindole is an indole derivative and useful synthetic intermediate.