Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-디이소프로필페닐 이소시아네이트
2,6-디이소프로필페닐이소시아네이트 · 2,6-디이소프로필페닐 이소시아네이트 · 2,6-Diisopropylphenyl · Benzene, 2-isocyanato-1,3-bis(1-methylethyl)- · 2,6-Diisopropylpheny · Diisopropylfenyliso-cyanat · 2,6-diisopropyl isocyanate · Diisopropylphenyl isocyanat
식별자 및 물리적 특성
| CAS No. | 28178-42-9 |
|---|---|
| 분자식 | C13H17NO |
| 평균 분자량 | 203.28 g/mol |
| 단동위원소 질량 | 203.13101416 g/mol |
| SMILES | CC(C)c1cccc(C(C)C)c1N=C=O |
| InChIKey | FEUFNKALUGDEMQ-UHFFFAOYSA-N |
| PubChem CID | 92259 |
| ChEMBL | CHEMBL109470 |
| EC No. | 248-885-4 |
| DTXSID | DTXSID9051959 |
| 현지명 | 2,6-디이소프로필페닐 이소시아네이트 |
화학 및 물리적 성질
| XLogP | 5 |
|---|---|
| 극성 표면적 | 29.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 225 |
| SpringerMaterials Properties | Chemical shift |
| 끓는 점 | 117 °C10 mm Hg(lit.) |
| 밀도 | 0.951 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.519(lit.) |
| 인화점 | 225 °F |
| 저장 조건 | 2-8°C |
| 용해도 | 에 용해됨클로로포름, 메탄올 (약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 무색 |
| 비중 | 0.951 |
| BRN | 2645721 |
| 안정성 | 수분에 민감한 |
| LogP(분배 계수) | 1.57 at 25℃ |
| EPA | 2,6-Diisopropylphenyl isocyanate (28178-42-9) |
화학적 성질
clear colorless to slightly yellow liquid
안전 및 규제
| GHS 분류 | DangerH302+H312 (69.8%): Harmful if swallowed or in contact with skin [Warning Acute toxicity, oralacute toxicity, dermal]P233, P260, P261, P264, P264+P265, P270, P271, P272, P280, P284, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P320, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P362+P364, P363, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 632 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzene, 2-isocyanato-1,3-bis(1-methylethyl)-Status: Active Update: 16-09-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/56302,6-Diisopropylphenylisocyanate: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 2 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | CY8545000 |
| 운송 번호(UN) | UN 3382 6.1/PG 1 |
| 관세 코드 | 29299010 |
| 위험 문구(R) | 26-36/37/38-42-21/22 |
| 위험 표시 | T+ |
| 안전 문구(S) | 23-26-36/37/39-45-28A |
| 포장분류 | II |
| 위험 등급 | 6.1 |
| 기존화학 물질 | 2014-1-719 |
| F 고인화성물질 | 19-21 |
| 함량 및 규제정보 | 물질구분: 유독물질혼합물(제품)함량정보: 2,6-디이소프로필페닐 이소시아네이트 및 이를 1% 이상 함유한 혼합물 |