Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(-)-gamma-Cadinene
(-)-γ-Cadinene · 7-methyl-4-methylidene-1-propan-2-yl-2,3,4a,5,6,8a-hexahydro-1H-naphthalene · (1S,4aR,8aR)-1-isopropyl-7-methyl-4-methylene-2,3,4a,5,6,8a-hexahydro-1H-naphthalene · Naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-7-methyl-4-methylene-1-(1-methylethyl)-, (1R,4aS,8aS)-
식별자 및 물리적 특성
| CAS No. | 1460-97-5 |
|---|---|
| 분자식 | C15H24 |
| 평균 분자량 | 204.35 g/mol |
| 단동위원소 질량 | 204.18780077 g/mol |
| SMILES | C=C1CC[C@H](C(C)C)[C@H]2C=C(C)CC[C@H]12 |
| InChIKey | WRHGORWNJGOVQY-RBSFLKMASA-N |
| PubChem CID | 92313 |
| ChEBI | CHEBI:63203 |
| DTXSID | DTXSID301017689 |
화학 및 물리적 성질
| XLogP | 4.3 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 282 |
| 끓는 점 | 271.00 to 276.00 °C. @ 760.00 mm Hg130-133 °C(Press: 4.3 Torr) |
| Physical Description | Liquid |
| 밀도 | 0.9189 g/cm3(Temp: 24 °C) |
| LogP(분배 계수) | 6.352 (est) |
용도
용도
(-)-γ-Cadinene is a sesquiterpene and can be isolated from A. terreus. It is an antioxidant agent.