Phenazine Methosulfate
PMS · PHENAZINE METHYL SULFATE · Phenazine methosuL · 5-Methylphenazinium · Phenazine methosulfa · Phezine methosulfate · PHENAZINE METHOSULFATE · Phenazine Methoshlphate
식별자 및 물리적 특성
| CAS No. | 299-11-6 |
|---|---|
| 분자식 | C14H14N2O4S |
| 평균 분자량 | 306.34 g/mol |
| 단동위원소 질량 | 306.06742793 g/mol |
| SMILES | COS(=O)(=O)[O-].C[n+]1c2ccccc2nc2ccccc21 |
| InChIKey | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| PubChem CID | 9285 |
| ChEBI | CHEBI:8055 |
| EC No. | 206-072-1 |
| DTXSID | DTXSID1059783 |
화학 및 물리적 성질
| 극성 표면적 | 91.6 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 297 |
| 물질 분류 | Nitrogen Compounds -> Other Aromatics (Nitrogen) |
| Physical Description | Yellow to brown solid[Merck Index] Yellow crystalline solid[Sigma-Aldrich MSDS] |
| 녹는점 | 158-160 °C (dec.)(lit.) |
| 밀도 | 1.3395 (rough estimate) |
| 굴절률 | 1.6930 (estimate) |
| 저장 조건 | -20°C |
| 용해도 | H2O: 20 °C에서 0.2 g/mL, 투명, 진한 주황색 |
| 물리적 상태 | 결정성 분말 |
| 색상 | 진한 노란색에서 갈색 또는 카키색 |
| 용해도 | soluble in water (approximately 200 mg/ml). |
| Merck | 14,6109 |
| BRN | 3898869 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | InChI=1S/C13H11N2.CH4O4S/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)151-5-6(2,3)4/h2-9H,1H31H3,(H,2,3,4)/q+1/p-1 |
| InChIKey | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| SMILES | C12C=CC=CC1=NC1=CC=CC=C1[N+]=2C.S([O-])(=O)(=O)OC |
| EPA | Phenazinium, 5-methyl-, methyl sulfate (299-11-6) |
화학적 성질
orange to light brown crystals or powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Phenazinium, 5-methyl-, methyl sulfate: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | A moderate irritant[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SG1645000 |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38-68-46 |
| 위험 표시 | Xi,Xn,T |
| 안전 문구(S) | 26-36/37/39-53-45 |
| F 고인화성물질 | 8 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
Phenazine is a free radical generator. It has been used as an electron transfer reactant in cell viability assays. Phenazine (10 μM) induces ssDNA break formation in the presence of the reducing agent NADPH in a cell-free plasmid cleavage assay when used at a concentration of 10 μM. It induces oxidative DNA damage in an alkaline comet assay and apoptosis in A375 melanoma cells when used at a concentration of 10 μM. Phenazine (20 nM) oxidizes cysteine-containing proteins in HepG2 cells.
용도
Phenazine Methosulfate is used in tyrosine transaminase test and for enzymic determination of ethanol in blood by the colorimetric micromethod. Used with ascorbic acid to determine nitric oxide reductase activity. Since the reduced PMS is easily oxidized by oxygen, it is used in assays as an electron carrier between enzymes and oxygen, cytochrome c, indophenols, or tetrazolium salts. The reduced PMS is used as an electron donor to reduce cytochrome c or in photosynthetic experiments. Usage of PMS for detection of specific dehydrogenases has been reported.
일반 설명
Phenazines are heterocyclic compounds produced as secondary metabolites by bacteria.