Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-옥소헥산이온산
3-옥소헥산이온산 · NSC18511 · 3-ketoadipate · 3-oxoadipic acid · 3-Ketoadipic acid · B-ketoadipic acid · 4-OXOHEXANEDIOIC ACID · 3-OXOHEXANEDIOIC ACID
식별자 및 물리적 특성
| CAS No. | 689-31-6 |
|---|---|
| 분자식 | C6H8O5 |
| 평균 분자량 | 160.12 g/mol |
| 단동위원소 질량 | 160.03717335 g/mol |
| SMILES | O=C(O)CCC(=O)CC(=O)O |
| InChIKey | RTGHRDFWYQHVFW-UHFFFAOYSA-N |
| PubChem CID | 93 |
| ChEBI | CHEBI:37440 |
| EC No. | 633-254-1 |
| DTXSID | DTXSID30218974 |
| 현지명 | 3-옥소헥산이온산 |
화학 및 물리적 성질
| XLogP | -0.9 |
|---|---|
| 극성 표면적 | 91.7 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 183 |
| 지질 | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Dicarboxylic acids [FA0117] |
| 녹는점 | 124 - 126 °C124-126 °C(lit.) |
| Physical Description | Solid |
| 끓는 점 | 412.2±25.0 °C(Predicted) |
| 밀도 | 1.405±0.06 g/cm3(Predicted) |
| 저장 조건 | −20°C |
| 용해도 | 아세토니트릴(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 3.13±0.32(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C6H8O5/c7-4(3-6(10)11)1-2-5(8)9/h1-3H2,(H,8,9)(H,10,11) |
| InChIKey | RTGHRDFWYQHVFW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CC(=O)CCC(O)=O |
| LogP(분배 계수) | -0.688 (est) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
용도
용도
3-Oxohexanedioic Acid is a degradation product of catechol in the presence of hydrogen peroxide; Also, it is derived from 3-Oxohexanedioic Acid Diethyl Ester (O856830), which is an intermediate used to prepare CMPF (C595000) which is a drug-binding inhibitor which is also a constituent of urine. CMPF can inhibit specific T4 binding in serum by increasing the free concentration of direct competitors.