Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-메틸-3-피롤리디놀
1-메틸-3-피롤리디놀 · N-Methyl-3-pyrrolidinol · 3-HYDROXY-1-METHYLPYRROLIDINE · 1-METHYL-PYRROLIDIN-3-OL · NSC 89279 · 3-Hydroxy-1-methyL · N-Methyl-3-hydroxy- · 1-Methyl-3-pyrrolidi
식별자 및 물리적 특성
| CAS No. | 13220-33-2 |
|---|---|
| 분자식 | C5H11NO |
| 평균 분자량 | 101.15 g/mol |
| 단동위원소 질량 | 101.08406397 g/mol |
| SMILES | CN1CCC(O)C1 |
| InChIKey | FLVFPAIGVBQGET-UHFFFAOYSA-N |
| PubChem CID | 93074 |
| ChEMBL | CHEMBL4752499 |
| EC No. | 236-189-3 |
| DTXSID | DTXSID10864377 |
| 현지명 | 1-메틸-3-피롤리디놀 |
화학 및 물리적 성질
| XLogP | -0.2 |
|---|---|
| 극성 표면적 | 23.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 65.1 |
| 물질 분류 | Nitrogen Compounds -> Amino Alcohols, Other |
| Physical Description | Colorless or pale yellow liquid[Alfa Aesar MSDS] |
| 끓는 점 | 50-52 °C1 mm Hg(lit.) |
| 밀도 | 0.921 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.464(lit.) |
| 인화점 | 159 °F |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 기름 |
| pKa(산도 계수) | 14.95±0.20(Predicted) |
| 색상 | 무색 |
| InChI | InChI=1S/C5H11NO/c1-6-3-2-5(7)4-6/h5,7H,2-4H2,1H3 |
| InChIKey | FLVFPAIGVBQGET-UHFFFAOYSA-N |
| SMILES | N1(C)CCC(O)C1 |
| NIST | 1-Methyl-3-pyrrolidinol(13220-33-2) |
화학적 성질
Clear colorless to pale yellow liquid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 1.9% (1 of 53) of reports.WarningH315 (96.2%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 53 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 18-07-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/247863-Pyrrolidinol, 1-methyl-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | A skin and strong eye irritant[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Irrit. 2 (96.2%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
1-Methyl-3-pyrrolidinol (cas# 13220-33-2) is a compound useful in organic synthesis.