Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
피리트라마이드
피리트라마이드 · A 65 · R 3365 · Pirdolan · Piridolan · Dipidolor · Pirtramide · piritramide
식별자 및 물리적 특성
| CAS No. | 302-41-0 |
|---|---|
| 분자식 | C27H34N4O |
| 평균 분자량 | 430.6 g/mol |
| 단동위원소 질량 | 430.27326172 g/mol |
| SMILES | N#CC(CCN1CCC(C(N)=O)(N2CCCCC2)CC1)(c1ccccc1)c1ccccc1 |
| InChIKey | IHEHEFLXQFOQJO-UHFFFAOYSA-N |
| PubChem CID | 9331 |
| ChEMBL | CHEMBL559288 |
| ChEBI | CHEBI:135699 |
| EC No. | 206-124-3 |
| DTXSID | DTXSID00184293 |
| 현지명 | 피리트라마이드 |
화학 및 물리적 성질
| XLogP | 3.7 |
|---|---|
| 극성 표면적 | 73.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 32 |
| 형식 전하 | 0 |
| 복잡도 | 638 |
| 의약품 | DEA NFLIS-Drug Category -> Narcotic AnalgesicsDEA Schedule I Controlled Substance -> OpiatesPharmaceuticals -> Synthetic Cannabinoids or Psychoactive CompoundsPharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | 3.91 |
| Human Drugs | Breast FeedingLactationMilk, HumanAnalgesics, OpioidNarcotics |
| 녹는점 | 149.5 °C149-150° |
| Physical Description | Solid |
| 끓는 점 | 544.82°C (rough estimate) |
| 밀도 | 1.0967 (rough estimate) |
| 굴절률 | 1.5900 (estimate) |
| 저장 조건 | Controlled Substance, -20°C Freezer |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 16.19±0.20(Predicted) |
| 색상 | 흰색에서 옅은 베이지까지 |
화학적 성질
Off-White Low Melting Solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P272, P273, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P362+P364, P391, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | DEA schedule I controlled substance |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Effects During Pregnancy and Lactation | ◉ Summary of Use during Lactation |
| 신호 어 | Danger |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
Piritramide is a synthetic opioid commonly used in Germany and Austria for the analgesia of pediatric patients.