Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-메톡시-알파-메틸-L-티로신
3-메톡시-알파-메틸-L-티로신 · (S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoic acid · Einecs 229-797-5 · Methyldopa IMpurity A · Methyldopa EP Impurity A · 3-O-Methyl-L-α-methyldopa · 3-Methoxy-α-methyl-L-tyrosine · L-Tyrosine, 3-methoxy-α-methyl-
식별자 및 물리적 특성
| CAS No. | 6739-31-7 |
|---|---|
| 분자식 | C11H15NO4 |
| 평균 분자량 | 225.24 g/mol |
| 단동위원소 질량 | 225.10010796 g/mol |
| SMILES | COc1cc(C[C@](C)(N)C(=O)O)ccc1O |
| InChIKey | BQHWFYPBSKGBMV-NSHDSACASA-N |
| PubChem CID | 94331 |
| ChEMBL | CHEMBL3544652 |
| ChEBI | CHEBI:141143 |
| EC No. | 229-797-5 |
| DTXSID | DTXSID80986671 |
| 현지명 | 3-메톡시-알파-메틸-L-티로신 |
화학 및 물리적 성질
| XLogP | -2.2 |
|---|---|
| 극성 표면적 | 92.8 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 258 |
| 녹는점 | 310 °C |
| 끓는 점 | 407.8±45.0 °C(Predicted) |
| 밀도 | 1.279±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 2.28±0.26(Predicted) |
| 주요 응용 | 의약품(소분자) |
| InChI | 1S/C11H15NO4/c1-11(12,10(14)15)6-7-3-4-8(13)9(5-7)16-2/h3-5,13H,6,12H2,1-2H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | BQHWFYPBSKGBMV-NSHDSACASA-N |
| SMILES | COc1cc(C[C@](C)(N)C(O)=O)ccc1O |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 위험 문구(R) | 22-36 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Methoxy-α-methyl-L-tyrosine is a metabolite of methylenedioxyamphetamine (M303965).