Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Diethyl (phenylmethylene)malonate
Diethyl 2-benzylidenemalonate · AI3-02423 · Ethyl benzalmalonate · DIETHYL BENZALMALONATE · Ethyl benzylidenemalonate · Benzalmalonic acid diethyl · b,b-Diethoxycarbonylstyrene · DIETHYL BENZYLIDENEMALONATE
식별자 및 물리적 특성
| CAS No. | 5292-53-5 |
|---|---|
| 분자식 | C14H16O4 |
| 평균 분자량 | 248.27 g/mol |
| 단동위원소 질량 | 248.10485899 g/mol |
| SMILES | CCOC(=O)C(=Cc1ccccc1)C(=O)OCC |
| InChIKey | VUWPIBNKJSEYIN-UHFFFAOYSA-N |
| PubChem CID | 94751 |
| ChEMBL | CHEMBL1496422 |
| EC No. | 226-137-8 |
| DTXSID | DTXSID30200975 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 52.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 294 |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 3.13 |
| 녹는점 | 28-31°C |
| 끓는 점 | 215-217 °C/30 mmHg (lit.) |
| 밀도 | 1.107 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.536(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색~황색 |
| 용해도 | 물에 불용성. |
| BRN | 528894 |
| 유전율 | 8.0(0℃) |
| InChI | 1S/C14H16O4/c1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | VUWPIBNKJSEYIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)\C(=C\c1ccccc1)C(=O)OCC |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P321, P330, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 02-07-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/18800 |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29173990 |
| 안전 문구(S) | 23-24/25 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Diethyl benzylidenemalonate is used as a pharmaceutical intermediate. It is also involved in the Conjugate addition of cyanide ion to arylidenemalonic esters provides a useful route to arylsuccinic acids.