Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4,5-Trifluoroaniline
2,4,5-Trifluoroanili · 2,4,5-tifluoroaniline · 2,4,5-trifluoroaniune · 2,4,5-TRIFLUOROANILINE · 2,4,5-Trifluoroaniline99% · 2,4,5-Trifluoroaniline,98% · 2,4,5-Trifluoroaniline 99% · 2,4,5-trifluorophenylaMine
식별자 및 물리적 특성
| CAS No. | 367-34-0 |
|---|---|
| 분자식 | C6H4F3N |
| 평균 분자량 | 147.1 g/mol |
| 단동위원소 질량 | 147.02958379 g/mol |
| SMILES | Nc1cc(F)c(F)cc1F |
| InChIKey | QMYVWJVVVMIBMM-UHFFFAOYSA-N |
| PubChem CID | 94953 |
| EC No. | 206-692-2 |
| DTXSID | DTXSID50190147 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 120 |
| 녹는점 | 59-63 °C(lit.) |
| 끓는 점 | 100.5°C (rough estimate) |
| 밀도 | 1.3510 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| pKa(산도 계수) | 2.25±0.10(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 베이지색 |
| BRN | 2085734 |
| InChI | InChI=1S/C6H4F3N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2 |
| InChIKey | QMYVWJVVVMIBMM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(F)C=C1F |
화학적 성질
beige crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2941 |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 20/21/22-36/37/38-41-38-21/22 |
| 위험 표시 | Xn,Xi,T |
| 안전 문구(S) | 26-36-36/37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
| 기존화학 물질 | KE-34236 |
| 위험 참고 사항 | Irritant |
용도
용도
2,4, 5-trifluoroaniline is a fluorinating reagent, mainly used as a raw material or intermediate in organic synthesis. It can react with acids to prepare 2,4, 5-trifluorophenacetic acid. It can also be used in the synthesis of agricultural chemicals, pharmaceuticals, dyes and special chemicals.