Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-벤조일-1,3-인다네디온
2-벤조일-1,3-인다네디온 · Benzoylindandione · 2-benzoyl-3-indandione · 2-BENZOYL-1,3-INDANDIONE · 2-BENZOYL-1,3-INDANEDIONE · 2-benzoylindene-1,3-dione · 1,3-Indandione, 2-benzoyl- · 2-Benzoyl-1,3-indanedione,98%
식별자 및 물리적 특성
| CAS No. | 1785-95-1 |
|---|---|
| 분자식 | C16H10O3 |
| 평균 분자량 | 250.25 g/mol |
| 단동위원소 질량 | 250.06299418 g/mol |
| SMILES | O=C(c1ccccc1)C1C(=O)c2ccccc2C1=O |
| InChIKey | UURMMRCWXJLUKF-UHFFFAOYSA-N |
| PubChem CID | 95022 |
| ChEMBL | CHEMBL1559211 |
| EC No. | 672-275-0 |
| DTXSID | DTXSID60170495 |
| 현지명 | 2-벤조일-1,3-인다네디온 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 51.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 382 |
| 녹는점 | 108-112 °C |
| 끓는 점 | 455.4±45.0 °C(Predicted) |
| 밀도 | 1.327±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 3.69±0.20(Predicted) |
| BRN | 2052944 |
화학적 성질
light yellow powder
안전 및 규제
| GHS 분류 | DangerH301 (20%): Toxic if swallowed [Danger Acute toxicity, oral]P262, P264, P270, P280, P301+P316, P301+P317, P302+P352, P316, P321, P330, P361+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (20%) |
| RTECS 번호 | NK5105000 |
| 독성 | mouse,LD50,oral,350mg/kg (350mg/kg),Medicina et Pharmacologia Experimentalis. Vol. 17, Pg. 497, 1967. |
| 관세 코드 | 29143900 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-36/37 |