Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,7-Dihydro-1,3-dimethyl-7-(phenylmethyl)-1H-purine-2,6-dione
7-Benzyltheophylline · 7-benzyl-1,3-dimethylpurine-2,6-dione · 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-7-(phenylmethyl)-
식별자 및 물리적 특성
| CAS No. | 1807-85-8 |
|---|---|
| 분자식 | C14H14N4O2 |
| 평균 분자량 | 270.29 g/mol |
| 단동위원소 질량 | 270.1116757 g/mol |
| SMILES | Cn1c(=O)c2c(ncn2Cc2ccccc2)n(C)c1=O |
| InChIKey | WXWQVDBZDNPNLZ-UHFFFAOYSA-N |
| PubChem CID | 95028 |
| ChEMBL | CHEMBL24759 |
| EC No. | 105-066-5 |
| DTXSID | DTXSID20170996 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 58.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 408 |
| 녹는점 | 158 °C |
| 끓는 점 | 489.6±37.0 °C(Predicted) |
| 밀도 | 1.33±0.1 g/cm3(Predicted) |
| 용해도 | 에 용해됨메오, DMSO |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 0.33±0.70(Predicted) |
| 색상 | 베이지색 |
용도
용도
7-Benzyltheophylline is an intermediate in the synthesis of Theophylline (T343850) which is a Xanthine derivative with diuretic, cardiac stimulant and smooth muscle relaxant activities; isomeric with theobromine. Small amounts occur in tea. Bronchodilator.