Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 95034생성일: 2026년 11월 5일
8-Aminotheophylline
8-aminotheophylline · 8-amino-1,3-dimethyl-7H-purine-2,6-dione · 1H-Purine-2,6-dione, 8-amino-3,9-dihydro-1,3-dimethyl- · 1H-Purine-2,6-dione, 8-amino-3,7-dihydro-1,3-dimethyl-
https://huagongshe.com/ko/chemical/95034
식별자 및 물리적 특성
| CAS No. | 19410-53-8 |
|---|
| 분자식 | C7H9N5O2 |
|---|
| 평균 분자량 | 195.18 g/mol |
|---|
| 단동위원소 질량 | 195.07562455 g/mol |
|---|
| SMILES | Cn1c(=O)c2[nH]c(N)nc2n(C)c1=O |
|---|
| InChIKey | ZZESAIGPDOBLKZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 95034 |
|---|
| ChEMBL | CHEMBL298737 |
|---|
| EC No. | 987-350-6 |
|---|
| DTXSID | DTXSID20173028 |
|---|
화학 및 물리적 성질
| XLogP | -0.4 |
|---|
| 극성 표면적 | 95.3 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 0 |
|---|
| 무거운 원자 수 | 14 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 294 |
|---|
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
|---|
| 녹는점 | >300 °C |
|---|
| 끓는 점 | 493.2±55.0 °C(Predicted) |
|---|
| 밀도 | 1.559±0.06 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 9.77±0.70(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
