Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ethyl 2,3-dihydro-4-methyl-3-(phenylmethyl)-2-thioxo-5-thiazolecarboxylate
Ethyl 3-benzyl-4-methyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylate · 3-Benzyl-4-methyl-2-thioxo-2,3-dihydro-thiazole-5-carboxylic acid ethyl ester · 5-Thiazolecarboxylic acid, 2,3-dihydro-4-methyl-3-(phenylmethyl)-2-thioxo-, ethyl ester
식별자 및 물리적 특성
| CAS No. | 670261-49-1 |
|---|---|
| 분자식 | C14H15NO2S2 |
| 평균 분자량 | 293.4 g/mol |
| 단동위원소 질량 | 293.05442107 g/mol |
| SMILES | CCOC(=O)c1sc(=S)n(Cc2ccccc2)c1C |
| InChIKey | HDJWQALKIJESLW-UHFFFAOYSA-N |
| PubChem CID | 950488 |
| ChEMBL | CHEMBL1420125 |
| DTXSID | DTXSID201145120 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 86.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 400 |
| 용해도 | 3.4 [ug/mL] (The mean of the results at pH 7.4) |
| 녹는점 | 87 °C(Solv: methanol (67-56-1)) |
| 끓는 점 | 417.9±55.0 °C(Predicted) |
| 밀도 | 1.30±0.1 g/cm3(Predicted) |
| pKa(산도 계수) | -3.34±0.60(Predicted) |