Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
피로포르피린디메틸에스테르
피로포르피린디메틸에스테르 · min · Nsc17451 · Pyroporphyrin · PYROPORPHYRIN DIMETHYL ESTER · Deuteroporphyrin 1X dimethyl ester · DEUTEROPORPHYRIN IX DIMETHYL ESTER · DeuteroporphyrinIX,dimethylester,min.97%
식별자 및 물리적 특성
| CAS No. | 10589-94-3 |
|---|---|
| 분자식 | C32H34N4O4 |
| 평균 분자량 | 538.6 g/mol |
| 단동위원소 질량 | 538.25800558 g/mol |
| SMILES | COC(=O)CCC1=C(C)c2cc3cc(C)c(cc4cc(C)c(cc5nc(cc1n2)C(CCC(=O)OC)=C5C)[nH]4)[nH]3 |
| InChIKey | CEPCOHFDZYMQHP-UHFFFAOYSA-N |
| PubChem CID | 95097 |
| EC No. | 234-195-0 |
| 현지명 | 피로포르피린디메틸에스테르 |
화학 및 물리적 성질
| XLogP | 3.7 |
|---|---|
| 극성 표면적 | 110 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 40 |
| 형식 전하 | 0 |
| 복잡도 | 887 |
| 녹는점 | 217-220 °C(lit.) |
| 끓는 점 | 996.4±65.0 °C(Predicted) |
| 밀도 | 1.226±0.06 g/cm3(Predicted) |
| 저장 조건 | -20°C |
| 용해도 | 클로로포름,디클로로메탄, DMSO에 용해됨 |
| 물리적 상태 | 수정 같은 |
| 색상 | 보라 |
| InChIKey | JDWKDJYBNJTDOW-RWJCOFQGSA-N |
| SMILES | COC(=O)CCc1c(C)c2cc3[nH]c(cc3C)cc4nc(cc4C)cc5[nH]c(cc1n2)c(CCC(=O)OC)c5C |
| EPA | 21H,23H-Porphine-2,18-dipropanoic acid, 3,7,12,17-tetramethyl-, dimethyl ester (10589-94-3) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2931900090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Reactant for synthesis of:Deuteroporphyrindimethylester Ru(II) complexesRh porphyrinsPorphyrin-linked nitroimidazole antibioticsPorphyrin-fullerene dyadsPorphyrin-platinum complexes